chaetoglobosin-510

ID: ALA473549

PubChem CID: 11627627

Max Phase: Preclinical

Molecular Formula: C34H42N2O2

Molecular Weight: 510.72

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Chaetoglobosin-510 | Chaetoglobolsin-510|chaetoglobosin-510|CHEMBL473549|CHEBI:198468|(1S,3E,7E,9S,11E,13S,16S,17R,18S)-16-ethyl-18-[(1R)-1-(1H-indol-3-yl)ethyl]-7,9,15-trimethyl-19-azatricyclo[11.7.0.01,17]icosa-3,7,11,14-tetraene-2,20-dione

Canonical SMILES:  CC[C@@H]1C(C)=C[C@@H]2/C=C/C[C@H](C)/C=C(\C)CC/C=C/C(=O)[C@]23C(=O)N[C@@H]([C@H](C)c2c[nH]c4ccccc24)[C@H]13

Standard InChI:  InChI=1S/C34H42N2O2/c1-6-26-23(4)19-25-14-11-13-22(3)18-21(2)12-7-10-17-30(37)34(25)31(26)32(36-33(34)38)24(5)28-20-35-29-16-9-8-15-27(28)29/h8-11,14-20,22,24-26,31-32,35H,6-7,12-13H2,1-5H3,(H,36,38)/b14-11+,17-10+,21-18+/t22-,24+,25-,26+,31-,32-,34+/m0/s1

Standard InChI Key:  MMDCZRJSKCICND-PYZWPHHPSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
    3.6163    0.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3485   -0.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3854   -0.9031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6901   -1.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1176   -1.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7270   -2.1712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0316   -2.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4591   -2.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2994   -2.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2626   -1.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5304   -1.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4928   -0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1888    0.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9210   -0.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4529    0.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1077   -0.5644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7123   -0.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1538    0.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8720    0.3392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5794    0.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5747    1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8564    1.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1428    1.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8502    2.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5757    1.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5838    2.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2725   -1.0734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8625    1.1625    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2619    0.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5266    1.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8063   -0.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8708    0.9042    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3318   -1.5013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6227   -1.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9518   -0.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6243   -0.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1151    0.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9334    0.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2585   -0.3971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7657   -1.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2917    1.1750    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 10 11  2  0
  4  6  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 11 12  1  0
 22 24  1  0
  1  2  1  0
 23 25  1  6
 12 13  2  0
 25 26  1  0
  6  7  1  0
 17 27  2  0
 20 14  1  0
  1 14  2  0
 18 28  1  1
 19 12  1  1
 15 29  1  0
  3  4  1  0
 29 30  1  1
  6  8  1  0
 29 31  1  0
 15 32  1  6
 31 36  1  0
 18 15  1  0
 15 16  1  0
 35 33  1  0
 33 34  1  0
 34 31  2  0
 16 17  1  0
 17 19  1  0
 35 36  2  0
 18 19  1  0
 36 37  1  0
  7  9  1  0
 37 38  2  0
  3  5  1  6
 38 39  1  0
  9 10  1  0
 39 40  2  0
 40 35  1  0
  2  3  1  0
 20 41  1  1
M  END

Alternative Forms

1. Parent:

   

   ALA473549

   Chaetoglobolsin-510

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 510.72

Molecular Weight (Monoisotopic): 510.3246

AlogP: 7.42

#Rotatable Bonds: 3

Polar Surface Area: 61.96

Molecular Species: NEUTRAL

HBA: 2

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 4

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 7.42

CX LogD: 7.42

Aromatic Rings: 2

Heavy Atoms: 38

QED Weighted: 0.33

Np Likeness Score: 2.37

References

1. Christian OE, Compton J, Christian KR, Mooberry SL, Valeriote FA, Crews P..  (2005)  Using jasplakinolide to turn on pathways that enable the isolation of new chaetoglobosins from Phomospis asparagi.,  68  (11): [PMID:16309305] [10.1021/np050293f]

Source

Source(1):

• Scientific Literature