The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,4R)-4-(5-Chloro-benzo[d]isoxazol-3-ylamino)-6-(3-fluoro-benzenesulfonyl)-2,2-dimethyl-chroman-3-ol ID: ALA473749
PubChem CID: 44564323
Max Phase: Preclinical
Molecular Formula: C24H20ClFN2O5S
Molecular Weight: 502.95
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)Oc2ccc(S(=O)(=O)c3cccc(F)c3)cc2[C@@H](Nc2noc3ccc(Cl)cc23)[C@@H]1O
Standard InChI: InChI=1S/C24H20ClFN2O5S/c1-24(2)22(29)21(27-23-18-10-13(25)6-8-20(18)33-28-23)17-12-16(7-9-19(17)32-24)34(30,31)15-5-3-4-14(26)11-15/h3-12,21-22,29H,1-2H3,(H,27,28)/t21-,22+/m1/s1
Standard InChI Key: FFFFDRTWHXOYSL-YADHBBJMSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
10.2115 -7.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2104 -8.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9251 -8.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9233 -6.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6385 -7.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6373 -8.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3540 -8.6422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0765 -8.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0777 -7.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3564 -6.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4831 -8.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7872 -7.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7930 -6.9855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3500 -6.1487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0213 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8030 -5.9314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2934 -5.2682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0277 -4.8453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8140 -4.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9909 -3.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3825 -3.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5945 -3.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4212 -4.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4972 -6.9855 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.7800 -6.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9089 -6.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0876 -7.7014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7815 -5.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0651 -5.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3483 -5.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3523 -6.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0692 -6.9873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6400 -6.9947 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.9833 -2.9365 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
16 17 1 0
17 19 1 0
18 15 1 0
5 10 1 0
6 7 1 0
18 19 2 0
7 8 1 0
19 20 1 0
8 9 1 0
20 21 2 0
9 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
23 18 1 0
8 11 1 0
1 24 1 0
24 25 1 0
8 12 1 0
24 26 2 0
2 3 1 0
24 27 2 0
9 13 1 6
3 6 2 0
25 28 2 0
10 14 1 1
28 29 1 0
1 2 2 0
29 30 2 0
14 15 1 0
30 31 1 0
15 16 2 0
31 32 2 0
32 25 1 0
5 4 2 0
31 33 1 0
22 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.95Molecular Weight (Monoisotopic): 502.0765AlogP: 5.14#Rotatable Bonds: 4Polar Surface Area: 101.66Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.88CX Basic pKa: 0.64CX LogP: 4.65CX LogD: 4.65Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.74
References 1. Zhang X, Qiu Y, Li X, Bhattacharjee S, Woods M, Kraft P, Lundeen SG, Sui Z.. (2009) Discovery and structure-activity relationships of a novel series of benzopyran-based K(ATP) openers for urge urinary incontinence., 17 (2): [PMID:19101153 ] [10.1016/j.bmc.2008.11.055 ]