3-((2-(9H-fluoren-9-yl)ethyl)(methyl)amino)-1-(4-(2,4-difluorophenyl)piperazin-1-yl)propan-1-one hydrochloride

ID: ALA473762

PubChem CID: 44564948

Max Phase: Preclinical

Molecular Formula: C29H32ClF2N3O

Molecular Weight: 475.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(CCC(=O)N1CCN(c2ccc(F)cc2F)CC1)CCC1c2ccccc2-c2ccccc21.Cl

Standard InChI:  InChI=1S/C29H31F2N3O.ClH/c1-32(14-12-26-24-8-4-2-6-22(24)23-7-3-5-9-25(23)26)15-13-29(35)34-18-16-33(17-19-34)28-11-10-21(30)20-27(28)31;/h2-11,20,26H,12-19H2,1H3;1H

Standard InChI Key:  PBJCMSSBVJYMHA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    8.4240    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.2456    0.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4689    0.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1834    0.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8979    0.0357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1834    1.2732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6123    0.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3268    0.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3268   -0.7893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6123   -1.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8979   -0.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0413   -1.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7557   -0.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4702   -1.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4702   -2.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7557   -2.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0413   -2.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9600    0.0357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9600   -0.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6745    0.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3890    0.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1034    0.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4091    0.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8571    0.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1120   -0.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9190   -0.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4711   -0.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2161    0.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1897    1.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9966    1.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2516    2.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6995    2.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8926    2.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6376    1.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7557    0.0357    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.1847   -2.4393    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2 18  1  0
  7  8  1  0
 18 19  1  0
  8  9  1  0
 18 20  1  0
  9 10  1  0
 20 21  1  0
 10 11  1  0
 21 22  1  0
 22 24  1  0
 23 30  1  0
 29 22  1  0
 23 24  2  0
  5  7  1  0
  9 12  1  0
  3  4  1  0
 12 13  2  0
  2  3  1  0
 13 14  1  0
 23 28  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 29 30  2  0
  4  5  1  0
 14 15  2  0
 15 16  1  0
  4  6  2  0
 16 17  2  0
 29 34  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 17 12  1  0
 13 35  1  0
  5 11  1  0
 15 36  1  0
M  END

Associated Targets(non-human)

Sstr1 Somatostatin receptor 1 (154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.58Molecular Weight (Monoisotopic): 475.2435AlogP: 5.14#Rotatable Bonds: 7
Polar Surface Area: 26.79Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.54CX LogP: 5.12CX LogD: 3.00
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -1.27

References

1. Troxler T, Hurth K, Mattes H, Prashad M, Schoeffter P, Langenegger D, Enz A, Hoyer D..  (2009)  Discovery of novel non-peptidic beta-alanine piperazine amide derivatives and their optimization to achiral, easily accessible, potent and selective somatostatin sst1 receptor antagonists.,  19  (5): [PMID:19208473] [10.1016/j.bmcl.2009.01.072]

Source