The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((2-(9H-fluoren-9-yl)ethyl)(methyl)amino)-1-(4-(2,4-difluorophenyl)piperazin-1-yl)propan-1-one hydrochloride ID: ALA473762
PubChem CID: 44564948
Max Phase: Preclinical
Molecular Formula: C29H32ClF2N3O
Molecular Weight: 475.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(CCC(=O)N1CCN(c2ccc(F)cc2F)CC1)CCC1c2ccccc2-c2ccccc21.Cl
Standard InChI: InChI=1S/C29H31F2N3O.ClH/c1-32(14-12-26-24-8-4-2-6-22(24)23-7-3-5-9-25(23)26)15-13-29(35)34-18-16-33(17-19-34)28-11-10-21(30)20-27(28)31;/h2-11,20,26H,12-19H2,1H3;1H
Standard InChI Key: PBJCMSSBVJYMHA-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
8.4240 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.2456 0.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4689 0.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1834 0.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8979 0.0357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1834 1.2732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6123 0.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3268 0.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3268 -0.7893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6123 -1.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8979 -0.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0413 -1.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7557 -0.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4702 -1.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4702 -2.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7557 -2.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0413 -2.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9600 0.0357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9600 -0.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6745 0.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3890 0.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1034 0.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4091 0.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8571 0.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1120 -0.6720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9190 -0.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4711 -0.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2161 0.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1897 1.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9966 1.4402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2516 2.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6995 2.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8926 2.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6376 1.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7557 0.0357 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.1847 -2.4393 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 18 1 0
7 8 1 0
18 19 1 0
8 9 1 0
18 20 1 0
9 10 1 0
20 21 1 0
10 11 1 0
21 22 1 0
22 24 1 0
23 30 1 0
29 22 1 0
23 24 2 0
5 7 1 0
9 12 1 0
3 4 1 0
12 13 2 0
2 3 1 0
13 14 1 0
23 28 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
29 30 2 0
4 5 1 0
14 15 2 0
15 16 1 0
4 6 2 0
16 17 2 0
29 34 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
17 12 1 0
13 35 1 0
5 11 1 0
15 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.58Molecular Weight (Monoisotopic): 475.2435AlogP: 5.14#Rotatable Bonds: 7Polar Surface Area: 26.79Molecular Species: BASEHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.54CX LogP: 5.12CX LogD: 3.00Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -1.27
References 1. Troxler T, Hurth K, Mattes H, Prashad M, Schoeffter P, Langenegger D, Enz A, Hoyer D.. (2009) Discovery of novel non-peptidic beta-alanine piperazine amide derivatives and their optimization to achiral, easily accessible, potent and selective somatostatin sst1 receptor antagonists., 19 (5): [PMID:19208473 ] [10.1016/j.bmcl.2009.01.072 ]