2-{4-[(Diethylamino)methyl]benzyl}-5,6-dimethoxybenzofuran-3(2H)-one

ID: ALA473766

Max Phase: Preclinical

Molecular Formula: C22H27NO4

Molecular Weight: 369.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)Cc1ccc(CC2Oc3cc(OC)c(OC)cc3C2=O)cc1

Standard InChI:  InChI=1S/C22H27NO4/c1-5-23(6-2)14-16-9-7-15(8-10-16)11-21-22(24)17-12-19(25-3)20(26-4)13-18(17)27-21/h7-10,12-13,21H,5-6,11,14H2,1-4H3

Standard InChI Key:  ITFZJKJHMZSAEV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   -1.3959  -14.9840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3111  -14.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0655  -13.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6186  -14.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2061  -15.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4436  -14.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8561  -15.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4436  -15.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6186  -15.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2379  -13.0181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8561  -16.5840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6811  -16.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6811  -15.1564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0936  -15.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5994  -13.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1165  -14.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8323  -13.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5440  -14.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5440  -14.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8323  -15.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1165  -14.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2599  -15.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9758  -14.9867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9758  -14.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2599  -13.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6916  -15.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4033  -14.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  5  9  2  0
  4  6  2  0
  3 10  2  0
 11 12  1  0
  8 11  1  0
 13 14  1  0
  7 13  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 24 25  1  0
 23 24  1  0
 26 27  1  0
 23 26  1  0
 22 23  1  0
 19 22  1  0
  2 15  1  0
M  END

Alternative Forms

  1. Parent:

    ALA473766

    ---

Associated Targets(non-human)

Ache Acetylcholinesterase and butyrylcholinesterase (AChE and BChE) (232 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bche Butyrylcholinesterase (745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ache Acetylcholinesterase (2577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 369.46Molecular Weight (Monoisotopic): 369.1940AlogP: 3.73#Rotatable Bonds: 8
Polar Surface Area: 48.00Molecular Species: BASEHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 9.21CX Basic pKa: 8.53CX LogP: 3.17CX LogD: 2.30
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.71Np Likeness Score: 0.03

References

1. Sheng R, Xu Y, Hu C, Zhang J, Lin X, Li J, Yang B, He Q, Hu Y..  (2009)  Design, synthesis and AChE inhibitory activity of indanone and aurone derivatives.,  44  (1): [PMID:18436348] [10.1016/j.ejmech.2008.03.003]

Source