(3S,4R)-2-(6-Benzenesulfonyl-3-hydroxy-2,2-dimethylchroman-4-yl)-6-chloro-benzo[d]isoxazol-3-one

ID: ALA473941

PubChem CID: 15953834

Max Phase: Preclinical

Molecular Formula: C24H20ClNO6S

Molecular Weight: 485.95

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)Oc2ccc(S(=O)(=O)c3ccccc3)cc2[C@@H](n2oc3cc(Cl)ccc3c2=O)[C@@H]1O

Standard InChI:  InChI=1S/C24H20ClNO6S/c1-24(2)22(27)21(26-23(28)17-10-8-14(25)12-20(17)32-26)18-13-16(9-11-19(18)31-24)33(29,30)15-6-4-3-5-7-15/h3-13,21-22,27H,1-2H3/t21-,22+/m1/s1

Standard InChI Key:  PVRBBRJYIAJEKC-YADHBBJMSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    5.2343   -6.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2331   -6.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9479   -7.2766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9461   -5.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6613   -6.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6601   -6.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3770   -7.2810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0996   -6.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1008   -6.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3794   -5.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5062   -7.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8103   -6.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8162   -5.6242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3795   -4.7902    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0452   -4.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7105   -4.3073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8296   -4.5627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9653   -3.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7899   -3.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2032   -2.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7931   -2.0997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9654   -2.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5559   -2.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5198   -5.6242    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.8026   -5.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9317   -4.9095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1103   -6.3402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8041   -4.3831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0877   -3.9706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3708   -4.3855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3748   -5.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0917   -5.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5520   -1.3864    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 15 19  1  0
 18 16  1  0
 16 14  1  0
  4  1  1  0
 15 17  2  0
  5 10  1  0
  6  7  1  0
 18 19  2  0
  7  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  2  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 22 23  2  0
 23 18  1  0
  8 11  1  0
  1 24  1  0
 24 25  1  0
  8 12  1  0
 24 26  2  0
  2  3  1  0
 24 27  2  0
  9 13  1  6
 25 28  2  0
  3  6  2  0
 28 29  1  0
 10 14  1  1
 29 30  2  0
 14 15  1  0
 30 31  1  0
  1  2  2  0
 31 32  2  0
 32 25  1  0
  5  4  2  0
 22 33  1  0
M  END

Associated Targets(Human)

ABCC9 Tclin Sulfonylurea receptor 2 (109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.95Molecular Weight (Monoisotopic): 485.0700AlogP: 4.20#Rotatable Bonds: 3
Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.16CX Basic pKa: CX LogP: 4.19CX LogD: 4.19
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -0.24

References

1. Zhang X, Qiu Y, Li X, Bhattacharjee S, Woods M, Kraft P, Lundeen SG, Sui Z..  (2009)  Discovery and structure-activity relationships of a novel series of benzopyran-based K(ATP) openers for urge urinary incontinence.,  17  (2): [PMID:19101153] [10.1016/j.bmc.2008.11.055]

Source