The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(6-((4-(methylsulfonyl)piperazin-1-yl)methyl)-4-morpholinopyrrolo[1,2-f][1,2,4]triazin-2-yl)-4-(trifluoromethyl)pyridin-2-yl)acrylamide ID: ALA4740055
PubChem CID: 162645185
Max Phase: Preclinical
Molecular Formula: C25H29F3N8O4S
Molecular Weight: 594.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)c3cc(CN4CCN(S(C)(=O)=O)CC4)cn3n2)cn1
Standard InChI: InChI=1S/C25H29F3N8O4S/c1-3-22(37)30-21-13-19(25(26,27)28)18(14-29-21)23-31-24(34-8-10-40-11-9-34)20-12-17(16-36(20)32-23)15-33-4-6-35(7-5-33)41(2,38)39/h3,12-14,16H,1,4-11,15H2,2H3,(H,29,30,37)
Standard InChI Key: OAQAPGBFBJSIFA-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
20.2983 -3.6335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1133 -3.6318 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.7038 -2.9246 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7552 -6.8657 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.0466 -6.4569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0435 -7.2741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1841 -4.8536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8894 -4.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8894 -3.6320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1841 -3.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4788 -4.4492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4788 -3.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6974 -3.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2143 -4.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6973 -4.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1832 -2.3987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8999 -1.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9010 -1.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1918 -0.7594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4798 -1.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4770 -1.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5947 -4.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5921 -5.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2984 -6.0855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0077 -5.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0063 -4.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2994 -4.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7137 -6.0899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3971 -4.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9885 -4.7459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1699 -4.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7614 -5.4494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1665 -6.1595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9847 -6.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3977 -5.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1612 -7.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5901 -3.2258 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.4233 -5.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1291 -6.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4271 -4.8674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8387 -5.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 2 0
4 6 2 0
12 10 1 0
11 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 11 1 0
10 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
8 22 1 0
25 28 1 0
14 29 1 0
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 4 1 0
4 36 1 0
27 1 1 0
1 37 1 0
28 38 1 0
38 39 1 0
38 40 2 0
39 41 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.62Molecular Weight (Monoisotopic): 594.1985AlogP: 1.85#Rotatable Bonds: 7Polar Surface Area: 125.27Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.07CX Basic pKa: 5.59CX LogP: 2.86CX LogD: 2.85Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.41Np Likeness Score: -1.73
References 1. Xiang HY,Wang X,Chen YH,Zhang X,Tan C,Wang Y,Su Y,Gao ZW,Chen XY,Xiong B,Gao ZB,Chen Y,Ding J,Meng LH,Yang CH. (2021) Identification of methyl (5-(6-((4-(methylsulfonyl)piperazin-1-yl)methyl)-4-morpholinopyrrolo[2,1-f][1,2,4]triazin-2-yl)-4-(trifluoromethyl)pyridin-2-yl)carbamate (CYH33) as an orally bioavailable, highly potent, PI3K alpha inhibitor for the treatment of advanced solid tumors., 209 [PMID:33109399 ] [10.1016/j.ejmech.2020.112913 ]