7-((3-(3-Fluorophenyl)-4,5-dihydroisoxazol-5-yl)methoxy)-4-methyl-2H-chromen-2-one

ID: ALA4740392

PubChem CID: 162645205

Max Phase: Preclinical

Molecular Formula: C20H16FNO4

Molecular Weight: 353.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2cc(OCC3CC(c4cccc(F)c4)=NO3)ccc12

Standard InChI:  InChI=1S/C20H16FNO4/c1-12-7-20(23)25-19-10-15(5-6-17(12)19)24-11-16-9-18(22-26-16)13-3-2-4-14(21)8-13/h2-8,10,16H,9,11H2,1H3

Standard InChI Key:  GIUSLHDEYATOJH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   20.5976  -26.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5964  -27.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3045  -27.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3027  -26.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0113  -26.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0121  -27.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7206  -27.7399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4289  -27.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4241  -26.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7150  -26.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7107  -25.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1382  -27.7349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8884  -27.7450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1810  -27.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4730  -27.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7301  -27.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1828  -28.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5909  -28.7281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3903  -28.5587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3733  -27.9336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0423  -27.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2304  -27.0989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7487  -27.7601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0846  -28.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8955  -28.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8990  -26.3519    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
  8 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 22 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740392

    ---

Associated Targets(Human)

UACC-903 (393 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.35Molecular Weight (Monoisotopic): 353.1063AlogP: 3.81#Rotatable Bonds: 4
Polar Surface Area: 61.03Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.09CX LogP: 3.81CX LogD: 3.81
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.88

References

1. Lingaraju GS,Balaji KS,Jayarama S,Anil SM,Kiran KR,Sadashiva MP.  (2018)  Synthesis of new coumarin tethered isoxazolines as potential anticancer agents.,  28  (23-24): [PMID:30396758] [10.1016/j.bmcl.2018.10.046]

Source