(R)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrodibenzo[f,h]pyrrolo[1,2-b]isoquinolin-6-yl nicotinate

ID: ALA4740398

PubChem CID: 162645208

Max Phase: Preclinical

Molecular Formula: C28H26N2O4

Molecular Weight: 454.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c3c(c4ccc(OC(=O)c5cccnc5)cc4c2cc1OC)CN1CCC[C@@H]1C3

Standard InChI:  InChI=1S/C28H26N2O4/c1-32-26-13-23-21-11-18-6-4-10-30(18)16-25(21)20-8-7-19(12-22(20)24(23)14-27(26)33-2)34-28(31)17-5-3-9-29-15-17/h3,5,7-9,12-15,18H,4,6,10-11,16H2,1-2H3/t18-/m1/s1

Standard InChI Key:  XWCYXOGNXFDUKF-GOSISDBHSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    5.3516  -13.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3505  -13.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7695  -13.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0608  -12.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7723  -13.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0618  -14.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7685  -15.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0642  -15.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3523  -15.6225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3475  -16.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0606  -16.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7655  -16.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4818  -14.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4826  -15.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1868  -15.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1853  -13.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8940  -14.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8976  -15.2108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6749  -15.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1533  -14.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6691  -14.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0584  -11.9315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7649  -11.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6397  -12.7533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6395  -11.9319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6340  -16.8487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9238  -16.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2104  -16.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9271  -15.6159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8859  -13.5703    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5058  -16.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7928  -16.8328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7871  -17.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5002  -18.0692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2103  -17.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  8  2  0
  7 14  2  0
 13  5  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 13 14  1  0
 13 16  1  0
 14 15  1  0
 15 18  1  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
  4 22  1  0
 22 23  1  0
  1 24  1  0
 24 25  1  0
 10 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 17 30  1  6
 28 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740398

    ---

Associated Targets(Human)

Bel-7402 (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.53Molecular Weight (Monoisotopic): 454.1893AlogP: 5.14#Rotatable Bonds: 4
Polar Surface Area: 60.89Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.99CX LogP: 4.53CX LogD: 2.94
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: 0.08

References

1. Han G,Qing L,Wu M,Wang Y,Liu Y,Liu X,Wang Z,Ding J,Meng LH,Wang Q.  (2019)  Design, synthesis, and biological activity evaluation of (-)-6-O-desmethylantofine analogues as potent anti-cancer agents.,  27  (14.0): [PMID:31171403] [10.1016/j.bmc.2019.05.030]

Source