The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N4-tert-butoxy-N1-((S)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl)-2-(pyrazine-2-carboxamido)succinamide ID: ALA4740404
PubChem CID: 129094241
Max Phase: Preclinical
Molecular Formula: C27H32N6O5
Molecular Weight: 520.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)[C@H](CC(=O)NOC(C)(C)C)NC(=O)c1cnccn1)C(=O)NCc1cccc2ccccc12
Standard InChI: InChI=1S/C27H32N6O5/c1-17(24(35)30-15-19-10-7-9-18-8-5-6-11-20(18)19)31-25(36)21(14-23(34)33-38-27(2,3)4)32-26(37)22-16-28-12-13-29-22/h5-13,16-17,21H,14-15H2,1-4H3,(H,30,35)(H,31,36)(H,32,37)(H,33,34)/t17-,21-/m0/s1
Standard InChI Key: MMQANFBEKPIIDG-UWJYYQICSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
1.7291 -8.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8874 -12.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3041 -12.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4787 -12.1285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4458 -8.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1583 -8.4291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8708 -8.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5833 -8.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2958 -8.8332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0083 -8.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7207 -8.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4333 -8.4166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1457 -8.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8582 -8.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8726 -9.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5815 -7.5999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7225 -9.6541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0065 -7.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4468 -9.6666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2827 -7.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5642 -7.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8551 -7.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5880 -10.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5898 -10.8983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3015 -9.6592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3051 -11.3092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0223 -12.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2894 -8.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5724 -8.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5717 -9.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2873 -10.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0052 -9.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0023 -8.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7309 -7.6010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0150 -7.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2984 -7.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3023 -8.4343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0186 -8.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
7 15 1 6
8 16 2 0
11 17 2 0
10 18 1 1
5 1 1 0
5 19 2 0
14 29 2 0
28 20 2 0
20 21 1 0
21 22 2 0
22 14 1 0
15 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 3 1 0
3 27 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
1 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.59Molecular Weight (Monoisotopic): 520.2434AlogP: 1.79#Rotatable Bonds: 10Polar Surface Area: 151.41Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.41CX Basic pKa: 0.30CX LogP: 0.62CX LogD: 0.58Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -0.92
References 1. Zhan W,Singh PK,Ban Y,Qing X,Ah Kioon MD,Fan H,Zhao Q,Wang R,Sukenick G,Salmon J,Warren JD,Ma X,Barrat FJ,Nathan CF,Lin G. (2020) Structure-Activity Relationships of Noncovalent Immunoproteasome β5i-Selective Dipeptides., 63 (21): [PMID:33095579 ] [10.1021/acs.jmedchem.0c01520 ]