Methyl 2-(6-(3-fluorophenyl)-4-oxo-7-((3-phenylpropyl)carbamoyl)quinazolin-3(4H)-yl)acetate

ID: ALA4740487

PubChem CID: 156788067

Max Phase: Preclinical

Molecular Formula: C27H24FN3O4

Molecular Weight: 473.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)Cn1cnc2cc(C(=O)NCCCc3ccccc3)c(-c3cccc(F)c3)cc2c1=O

Standard InChI:  InChI=1S/C27H24FN3O4/c1-35-25(32)16-31-17-30-24-15-22(26(33)29-12-6-9-18-7-3-2-4-8-18)21(14-23(24)27(31)34)19-10-5-11-20(28)13-19/h2-5,7-8,10-11,13-15,17H,6,9,12,16H2,1H3,(H,29,33)

Standard InChI Key:  DHRDLIHXVRXLEA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   32.2722   -3.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2711   -3.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9858   -4.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9840   -2.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6993   -3.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7028   -3.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4219   -4.3738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1423   -3.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1389   -3.1236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4151   -2.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4105   -1.8828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5576   -2.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5609   -1.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8471   -1.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1318   -1.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1347   -2.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5562   -4.3724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8421   -3.9594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5556   -5.1974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8428   -3.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1274   -4.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4132   -3.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4139   -3.1332    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.6985   -4.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9844   -3.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9900   -3.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2768   -2.7212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5611   -3.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5630   -3.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2769   -4.3717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8520   -2.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5678   -3.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2809   -2.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5703   -3.9442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9966   -3.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  1 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 20  2  0
 20 12  1  0
 16 23  1  0
  2 17  1  0
 17 18  1  0
 17 19  2  0
 18 21  1  0
 21 22  1  0
 22 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  9 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740487

    ---

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.50Molecular Weight (Monoisotopic): 473.1751AlogP: 3.74#Rotatable Bonds: 8
Polar Surface Area: 90.29Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.64CX LogP: 3.89CX LogD: 3.89
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -1.18

References

1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G.  (2020)  Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy.,  207  [PMID:32920426] [10.1016/j.ejmech.2020.112723]

Source