1-(4-(bis(4-chlorophenyl)methyl)piperazin-1-yl)propane-1,2-dione

ID: ALA4740507

PubChem CID: 145865993

Max Phase: Preclinical

Molecular Formula: C20H20Cl2N2O2

Molecular Weight: 391.30

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)C(=O)N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C20H20Cl2N2O2/c1-14(25)20(26)24-12-10-23(11-13-24)19(15-2-6-17(21)7-3-15)16-4-8-18(22)9-5-16/h2-9,19H,10-13H2,1H3

Standard InChI Key:  QAJGXQUEUPPMPH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   17.0186   -3.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6082   -3.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6082   -4.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0204   -2.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6107   -1.8419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7848   -1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3703   -2.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7866   -3.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7840   -4.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3695   -5.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7842   -6.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6134   -6.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0200   -5.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3692   -1.1269    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.3705   -6.8381    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.8436   -3.9842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2582   -4.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2582   -3.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0832   -3.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4936   -3.9842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3186   -3.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0832   -4.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7333   -3.2691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7333   -4.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3186   -5.4142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5583   -4.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  2  1  0
  3  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  3  1  0
  6 14  1  0
 11 15  1  0
  1 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 17 22  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  2  0
 21 24  1  0
 24 25  2  0
 24 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740507

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 391.30Molecular Weight (Monoisotopic): 390.0902AlogP: 3.82#Rotatable Bonds: 4
Polar Surface Area: 40.62Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.77CX LogP: 4.27CX LogD: 4.27
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.74Np Likeness Score: -1.05

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source