5-[2-(dimethylamino)ethyl]-2,3-dimethoxy-11-methyl-benzo[c][1,5]benzodiazocine-6,12-dione

ID: ALA4740541

PubChem CID: 162644977

Max Phase: Preclinical

Molecular Formula: C21H25N3O4

Molecular Weight: 383.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)N(CCN(C)C)C(=O)c1ccccc1N(C)C2=O

Standard InChI:  InChI=1S/C21H25N3O4/c1-22(2)10-11-24-17-13-19(28-5)18(27-4)12-15(17)20(25)23(3)16-9-7-6-8-14(16)21(24)26/h6-9,12-13H,10-11H2,1-5H3

Standard InChI Key:  JXOYMGCFONOFPK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    3.8039  -20.5742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8027  -21.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5108  -21.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5090  -20.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6268  -21.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8081  -21.9633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2244  -21.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2176  -20.5706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7916  -19.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6103  -19.9801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1923  -20.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2008  -21.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9133  -21.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6178  -21.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6054  -20.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8923  -20.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9458  -22.7088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3943  -22.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5771  -22.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1628  -23.3644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3456  -23.3578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5656  -24.0754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4726  -19.2346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9170  -19.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0961  -20.1658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0959  -19.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0947  -21.8018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3873  -21.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  7  2  0
  8  4  2  0
  4  1  1  0
 12  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 17  2  0
  6 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
  9 23  2  0
 10 24  1  0
  1 25  1  0
 25 26  1  0
  2 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740541

    ---

Associated Targets(Human)

SLC6A4 Tclin Serotonin transporter (12625 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HRH1 Tclin Histamine H1 receptor (7573 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.45Molecular Weight (Monoisotopic): 383.1845AlogP: 2.50#Rotatable Bonds: 5
Polar Surface Area: 62.32Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.12CX LogP: 1.62CX LogD: 0.82
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.79Np Likeness Score: -0.58

References

1. Bieszczad B,Siwek A,Wilczek M,Trzybiński D,Woźniak K,Satała G,Bojarski AJ,Mieczkowski A.  (2020)  Synthesis, crystal structure and biological activity of novel analogues of tricyclic drugs.,  30  (21.0): [PMID:32798652] [10.1016/j.bmcl.2020.127493]

Source