The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(N,N-Dimethylamino)propoxy)-N-(2-(4-fluorophenoxy)phenyl)benzamide ID: ALA4740547
PubChem CID: 162644998
Max Phase: Preclinical
Molecular Formula: C24H25FN2O3
Molecular Weight: 408.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCOc1ccc(C(=O)Nc2ccccc2Oc2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C24H25FN2O3/c1-27(2)16-5-17-29-20-12-8-18(9-13-20)24(28)26-22-6-3-4-7-23(22)30-21-14-10-19(25)11-15-21/h3-4,6-15H,5,16-17H2,1-2H3,(H,26,28)
Standard InChI Key: WACSPZUQGDMPGQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
37.3871 -12.9553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3860 -13.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0940 -14.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8037 -13.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8009 -12.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0923 -12.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5121 -14.1819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2191 -13.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9275 -14.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6345 -13.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3429 -14.1774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6793 -12.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6791 -11.7297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.9717 -12.9557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2639 -12.5472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2674 -11.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5604 -11.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8518 -11.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8546 -12.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5622 -12.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5654 -13.7732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8593 -14.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1532 -13.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4476 -14.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4504 -15.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1647 -15.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8674 -14.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3442 -14.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0500 -13.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7449 -15.4191 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
1 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
11 28 1 0
11 29 1 0
25 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.47Molecular Weight (Monoisotopic): 408.1849AlogP: 5.20#Rotatable Bonds: 9Polar Surface Area: 50.80Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.26CX LogP: 4.63CX LogD: 2.78Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: -1.43
References 1. Cardoso FC,Marliac MA,Geoffroy C,Schmit M,Bispat A,Lewis RJ,Tuck KL,Duggan PJ. (2020) The neuronal calcium ion channel activity of constrained analogues of MONIRO-1., 28 (18): [PMID:32828422 ] [10.1016/j.bmc.2020.115655 ]