The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[2-[4-[2-(4-isobutylphenyl)propanoyl]piperazin-1-yl]phenyl]-N-(3-pyrrolidin-1-ylpropyl)pyridine-3-carboxamide ID: ALA4740553
PubChem CID: 162645002
Max Phase: Preclinical
Molecular Formula: C36H47N5O2
Molecular Weight: 581.81
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Cc1ccc(C(C)C(=O)N2CCN(c3ccccc3-c3cncc(C(=O)NCCCN4CCCC4)c3)CC2)cc1
Standard InChI: InChI=1S/C36H47N5O2/c1-27(2)23-29-11-13-30(14-12-29)28(3)36(43)41-21-19-40(20-22-41)34-10-5-4-9-33(34)31-24-32(26-37-25-31)35(42)38-15-8-18-39-16-6-7-17-39/h4-5,9-14,24-28H,6-8,15-23H2,1-3H3,(H,38,42)
Standard InChI Key: UNPRJQIJMSHEIP-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
21.8818 -21.2502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8807 -22.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5952 -22.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3155 -22.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3127 -21.2465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5935 -20.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0295 -20.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7495 -21.2412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0264 -19.9985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4663 -20.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1861 -21.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9029 -20.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6229 -21.2304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7086 -22.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5201 -22.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9298 -21.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3715 -20.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5944 -23.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8779 -23.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8762 -24.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5904 -24.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3076 -24.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3056 -23.7244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1647 -23.3104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1709 -22.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4619 -22.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7443 -22.4806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7402 -23.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4538 -23.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0327 -22.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0379 -21.2391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3159 -22.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3107 -23.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5920 -23.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5865 -24.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2985 -24.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0177 -24.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0197 -23.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6043 -22.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2944 -25.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0066 -26.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0024 -27.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7228 -25.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
3 18 1 0
19 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
32 39 1 0
36 40 1 0
40 41 1 0
41 42 1 0
41 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.81Molecular Weight (Monoisotopic): 581.3730AlogP: 5.62#Rotatable Bonds: 11Polar Surface Area: 68.78Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.28CX LogP: 5.21CX LogD: 3.34Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.30Np Likeness Score: -1.16
References 1. Zhang B,Liao L,Wu F,Zhang F,Sun Z,Chen H,Luo C. (2020) Synthesis and structure-activity relationship studies of LLY-507 analogues as SMYD2 inhibitors., 30 (22): [PMID:33011288 ] [10.1016/j.bmcl.2020.127598 ]