The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(5-(4-(1-((5-cyclopropyl-1H-pyrazol-3-yl)amino)-1-oxopropan-2-yl)phenyl)pyridin-2-yl)-4-morpholinobut-2-enamide ID: ALA4740577
PubChem CID: 155175686
Max Phase: Preclinical
Molecular Formula: C28H32N6O3
Molecular Weight: 500.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C(=O)Nc1cc(C2CC2)[nH]n1)c1ccc(-c2ccc(NC(=O)/C=C/CN3CCOCC3)nc2)cc1
Standard InChI: InChI=1S/C28H32N6O3/c1-19(28(36)31-26-17-24(32-33-26)22-8-9-22)20-4-6-21(7-5-20)23-10-11-25(29-18-23)30-27(35)3-2-12-34-13-15-37-16-14-34/h2-7,10-11,17-19,22H,8-9,12-16H2,1H3,(H,29,30,35)(H2,31,32,33,36)/b3-2+
Standard InChI Key: JDHQEFMWJITKOK-NSCUHMNNSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
10.9126 -11.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6206 -11.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3248 -11.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3248 -12.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6232 -13.2199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9126 -12.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2004 -13.2262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4924 -12.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7843 -13.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0762 -12.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3640 -13.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6560 -12.8145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9479 -13.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2399 -12.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2399 -11.9950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9479 -11.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6560 -11.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4924 -11.9950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0370 -11.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0374 -10.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7429 -10.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4513 -10.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4535 -11.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7494 -11.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1594 -10.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1594 -9.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8716 -10.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8716 -11.5849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5796 -10.3578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2877 -10.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9999 -10.3578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6132 -10.9245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2845 -11.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4665 -11.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6922 -12.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6922 -13.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4037 -12.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 1 0
8 18 2 0
19 3 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
22 25 1 0
25 26 1 0
25 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
31 30 2 0
31 32 1 0
32 33 1 0
34 33 2 0
30 34 1 0
35 33 1 0
35 36 1 0
36 37 1 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.60Molecular Weight (Monoisotopic): 500.2536AlogP: 3.92#Rotatable Bonds: 9Polar Surface Area: 112.24Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.22CX Basic pKa: 6.33CX LogP: 3.72CX LogD: 3.69Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: -1.25
References 1. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 2. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 3. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors,