4-Benzy1-1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidine

ID: ALA4740593

PubChem CID: 162645166

Max Phase: Preclinical

Molecular Formula: C22H27N

Molecular Weight: 305.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(CC2CCN(C3CCc4ccccc4C3)CC2)cc1

Standard InChI:  InChI=1S/C22H27N/c1-2-6-18(7-3-1)16-19-12-14-23(15-13-19)22-11-10-20-8-4-5-9-21(20)17-22/h1-9,19,22H,10-17H2

Standard InChI Key:  VFXPONVZYRUQFR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   28.1215  -20.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1204  -21.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8284  -21.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8266  -20.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5352  -20.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5341  -21.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2403  -21.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9522  -21.4180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9533  -20.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2426  -20.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6620  -20.1905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3674  -20.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0739  -20.2014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0801  -19.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3736  -18.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6608  -19.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7904  -18.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4955  -19.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4876  -20.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1919  -20.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9031  -20.2166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9056  -19.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2006  -18.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740593

    ---

Associated Targets(Human)

GRIN2B Tclin Glutamate [NMDA] receptor subunit epsilon 2 (467 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Tmem97 Sigma intracellular receptor 2 (922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 305.46Molecular Weight (Monoisotopic): 305.2143AlogP: 4.50#Rotatable Bonds: 3
Polar Surface Area: 3.24Molecular Species: BASEHBA: 1HBD:
#RO5 Violations: HBA (Lipinski): 1HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.08CX LogP: 5.46CX LogD: 2.84
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.81Np Likeness Score: -0.21

References

1. Temme L,Bechthold E,Schreiber JA,Gawaskar S,Schepmann D,Robaa D,Sippl W,Seebohm G,Wünsch B.  (2020)  Negative allosteric modulators of the GluN2B NMDA receptor with phenylethylamine structure embedded in ring-expanded and ring-contracted scaffolds.,  190  [PMID:32070917] [10.1016/j.ejmech.2020.112138]

Source