The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[(tert-butylamino)methyl]-1-(4-chlorophenyl)-3-ethoxycarbonyl-5-(4-nitrophenyl)-1H-pyrazole chloride ID: ALA4740598
PubChem CID: 162645171
Max Phase: Preclinical
Molecular Formula: C23H26Cl2N4O4
Molecular Weight: 456.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1nn(-c2ccc(Cl)cc2)c(-c2ccc([N+](=O)[O-])cc2)c1CNC(C)(C)C.Cl
Standard InChI: InChI=1S/C23H25ClN4O4.ClH/c1-5-32-22(29)20-19(14-25-23(2,3)4)21(15-6-10-18(11-7-15)28(30)31)27(26-20)17-12-8-16(24)9-13-17;/h6-13,25H,5,14H2,1-4H3;1H
Standard InChI Key: DSAKHHBKXBHKFO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
21.4643 -27.1678 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.8187 -27.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0353 -28.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6198 -27.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5379 -32.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5368 -33.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2515 -33.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9679 -33.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9650 -32.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2496 -31.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2515 -31.0379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9183 -30.5520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6609 -29.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8349 -29.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5845 -30.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8050 -30.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1891 -30.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4066 -30.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2388 -31.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8597 -31.8853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6399 -31.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1433 -29.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9641 -29.1812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4465 -28.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2672 -28.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8050 -28.3457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3464 -29.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5265 -29.1969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2181 -28.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2513 -34.3363 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.4534 -31.6013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8367 -31.0533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2873 -32.4092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
12 13 2 0
11 12 1 0
13 14 1 0
14 15 2 0
15 11 1 0
10 11 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 16 1 0
13 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
22 26 2 0
14 27 1 0
27 28 1 0
28 3 1 0
3 29 1 0
7 30 1 0
31 32 1 0
31 33 2 0
19 31 1 0
M CHG 2 31 1 32 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.93Molecular Weight (Monoisotopic): 456.1564AlogP: 5.17#Rotatable Bonds: 7Polar Surface Area: 99.29Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.47CX LogP: 5.33CX LogD: 4.23Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: -1.42
References 1. da Silva MJV,Jacomini AP,Figueiredo MC,Back DF,Foglio MA,Ruiz ALTG,Paula FR,Rosa FA. (2021) Efficient synthesis and antitumor evaluation of 4-aminomethyl-N-arylpyrazoles: Discovery of potent and selective agents for ovarian cancer., 29 [PMID:33214037 ] [10.1016/j.bmc.2020.115835 ]