The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-Dihydroxyphenethyl)-5-nitro-6-(4-tosylpiperazin-1-yl)-1H-benzo[de]isoquinoline-1,3(2H)-dion ID: ALA4740633
PubChem CID: 162644608
Max Phase: Preclinical
Molecular Formula: C31H28N4O8S
Molecular Weight: 616.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)N2CCN(c3c([N+](=O)[O-])cc4c5c(cccc35)C(=O)N(CCc3ccc(O)c(O)c3)C4=O)CC2)cc1
Standard InChI: InChI=1S/C31H28N4O8S/c1-19-5-8-21(9-6-19)44(42,43)33-15-13-32(14-16-33)29-22-3-2-4-23-28(22)24(18-25(29)35(40)41)31(39)34(30(23)38)12-11-20-7-10-26(36)27(37)17-20/h2-10,17-18,36-37H,11-16H2,1H3
Standard InChI Key: XGOATHMPYPQXFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
24.2103 -17.3013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9998 -18.0938 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.7913 -17.8798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3480 -19.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3029 -18.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9129 -18.9406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1197 -18.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7361 -18.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3134 -17.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5021 -17.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5423 -18.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1632 -19.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5955 -20.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4067 -20.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7838 -19.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3494 -18.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7033 -16.7462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2774 -16.0487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5202 -16.7261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5524 -18.1396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9748 -18.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7883 -18.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1855 -18.1103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7631 -17.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9434 -17.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0962 -18.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8739 -17.5269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9648 -20.3541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6651 -18.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4236 -18.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0262 -19.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4465 -20.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2644 -20.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6603 -19.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2377 -18.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6863 -20.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8484 -18.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4203 -17.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6533 -19.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4678 -19.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2178 -18.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6027 -17.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0328 -17.0369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4100 -18.2088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 12 1 0
4 6 1 0
7 5 1 0
5 6 1 0
7 11 1 0
7 10 2 0
16 8 1 0
8 9 2 0
9 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
17 19 1 0
9 17 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
8 20 1 0
23 2 1 0
6 26 1 0
5 27 2 0
4 28 2 0
26 29 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
29 37 1 0
37 38 2 0
38 42 1 0
41 39 1 0
39 40 2 0
40 37 1 0
41 42 2 0
42 43 1 0
44 41 1 0
M CHG 2 17 1 19 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.65Molecular Weight (Monoisotopic): 616.1628AlogP: 3.82#Rotatable Bonds: 7Polar Surface Area: 161.60Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.29CX Basic pKa: ┄CX LogP: 4.56CX LogD: 4.55Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.14Np Likeness Score: -1.05
References 1. Liang GB,Wei JH,Jiang H,Huang RZ,Qin JT,Wang HL,Wang HS,Zhang Y. (2021) Design, synthesis and antitumor evaluation of new 1,8-naphthalimide derivatives targeting nuclear DNA., 210 [PMID:33109400 ] [10.1016/j.ejmech.2020.112951 ]