The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((5-(4-(1-((5-cyclopropyl-1H-pyrazol-3-yl)amino)-1-oxopropan-2-yl)phenyl)-3-fluoropyridin-2-yl)methyl)acrylamide ID: ALA4740663
PubChem CID: 162644855
Max Phase: Preclinical
Molecular Formula: C24H24FN5O2
Molecular Weight: 433.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)NCc1ncc(-c2ccc([C@H](C)C(=O)Nc3cc(C4CC4)[nH]n3)cc2)cc1F
Standard InChI: InChI=1S/C24H24FN5O2/c1-3-23(31)27-13-21-19(25)10-18(12-26-21)16-6-4-15(5-7-16)14(2)24(32)28-22-11-20(29-30-22)17-8-9-17/h3-7,10-12,14,17H,1,8-9,13H2,2H3,(H,27,31)(H2,28,29,30,32)/t14-/m0/s1
Standard InChI Key: NBKCLUUFNNVWBJ-AWEZNQCLSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
9.3613 -11.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0741 -11.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7830 -11.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7830 -12.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0767 -12.7726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3613 -12.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6443 -12.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9315 -12.3644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2187 -12.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2187 -13.5999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5059 -12.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7889 -12.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5000 -11.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5003 -10.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2106 -9.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9237 -10.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9260 -11.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2171 -11.5368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6365 -9.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6365 -9.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3535 -10.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3535 -11.1267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0663 -9.8913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7791 -10.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4961 -9.8913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1135 -10.4618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7827 -11.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9592 -11.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1931 -11.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1931 -12.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9094 -12.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6492 -11.1229 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
9 8 1 0
9 10 2 0
11 9 1 0
12 11 2 0
13 3 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 6
19 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
25 24 2 0
25 26 1 0
26 27 1 0
28 27 2 0
24 28 1 0
29 27 1 0
29 30 1 0
30 31 1 0
29 31 1 0
1 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.49Molecular Weight (Monoisotopic): 433.1914AlogP: 4.03#Rotatable Bonds: 8Polar Surface Area: 99.77Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.26CX Basic pKa: 2.09CX LogP: 3.46CX LogD: 3.46Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.23
References 1. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors,