Methyl 2-(6-(3-(dimethylamino)phenoxy)-7-(2-((4-fluorobenzyl)oxy)acetamido)-4-oxoquinazolin-3(4H)-yl)acetate

ID: ALA4740705

PubChem CID: 162645004

Max Phase: Preclinical

Molecular Formula: C28H27FN4O6

Molecular Weight: 534.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)Cn1cnc2cc(NC(=O)COCc3ccc(F)cc3)c(Oc3cccc(N(C)C)c3)cc2c1=O

Standard InChI:  InChI=1S/C28H27FN4O6/c1-32(2)20-5-4-6-21(11-20)39-25-12-22-23(30-17-33(28(22)36)14-27(35)37-3)13-24(25)31-26(34)16-38-15-18-7-9-19(29)10-8-18/h4-13,17H,14-16H2,1-3H3,(H,31,34)

Standard InChI Key:  BLJXVVQWQFUPEN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   32.6732  -15.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6721  -16.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3869  -16.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3850  -15.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1004  -15.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1038  -16.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8230  -16.7906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5435  -16.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5400  -15.5402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8162  -15.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8116  -14.2994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2532  -15.1255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9538  -16.7873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9585  -15.1368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.2413  -16.3715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9587  -14.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9689  -15.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6728  -13.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6734  -13.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9586  -12.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2416  -13.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2445  -13.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2452  -15.5465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5249  -16.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8124  -16.3647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0960  -16.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3835  -16.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3906  -15.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6790  -15.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9616  -15.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9603  -16.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6725  -16.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9715  -16.3608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6821  -15.1212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5269  -12.6707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5264  -11.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8127  -13.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3978  -15.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2488  -15.1108    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  9 12  1  0
  2 13  1  0
  1 14  1  0
 13 15  1  0
 14 16  1  0
 12 17  1  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 15 23  2  0
 15 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 17 33  2  0
 17 34  1  0
 21 35  1  0
 35 36  1  0
 35 37  1  0
 34 38  1  0
 30 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740705

    ---

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.54Molecular Weight (Monoisotopic): 534.1915AlogP: 3.72#Rotatable Bonds: 10
Polar Surface Area: 111.99Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.14CX Basic pKa: 4.35CX LogP: 3.11CX LogD: 3.11
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -1.64

References

1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G.  (2020)  Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy.,  207  [PMID:32920426] [10.1016/j.ejmech.2020.112723]

Source