(E/Z)-29-hydroxystelliferin A

ID: ALA474075

PubChem CID: 10720560

Max Phase: Preclinical

Molecular Formula: C32H48O5

Molecular Weight: 512.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: (E/Z)-29-Hydroxystelliferin A | CHEMBL474075|(E/Z)-29-hydroxystelliferin A

Canonical SMILES:  CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)/C(=C(C)/C=C/C=C(\C)[C@@H](O)CC=C(C)C)C(=O)C[C@@H]23)[C@@]1(C)CO

Standard InChI:  InChI=1S/C32H48O5/c1-20(2)12-13-24(35)21(3)10-9-11-22(4)29-25(36)18-27-30(6)17-15-28(37-23(5)34)32(8,19-33)26(30)14-16-31(27,29)7/h9-12,24,26-28,33,35H,13-19H2,1-8H3/b11-9+,21-10+,29-22+/t24-,26+,27-,28-,30-,31-,32+/m0/s1

Standard InChI Key:  QDIPGNADJXRSEJ-BLOHMGETSA-N

Molfile:  

     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
    9.0332   -0.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0332   -1.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7476   -2.1724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7476   -0.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4666   -0.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4677   -1.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1827   -2.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9011   -1.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1805   -0.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9009   -0.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5219   -0.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1852    0.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3562    0.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3188   -2.1724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6044   -1.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8898   -2.1724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6044   -0.9349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7390   -2.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4585   -0.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6079   -1.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4585   -2.5802    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7609    0.2062    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.5998    1.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3458   -0.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7620   -1.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7546    0.3454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5795    0.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9883    1.0662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8132    1.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2220    1.7871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2293    0.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0469    1.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8058    2.4993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4557    2.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2806    2.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6893    3.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6968    1.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0285   -2.5802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0240   -3.4052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8 10  1  0
  5 19  1  1
  9 10  1  0
 10 20  1  6
  3  6  1  0
  6 21  1  6
  5  4  1  0
  9 22  1  1
  5  6  1  0
 12 23  2  0
 11 24  2  0
  1  2  1  0
 24 25  1  0
 10 11  1  0
 24 26  1  0
 11 12  1  0
 26 27  2  0
 12 13  1  0
 27 28  1  0
 13  9  1  0
 28 29  2  0
  1  4  1  0
 29 30  1  0
  2 14  1  1
 29 31  1  0
  2  3  1  0
 30 32  1  0
 14 15  1  0
 30 33  1  1
  5  9  1  0
 32 34  1  0
 15 16  1  0
 34 35  2  0
  6  7  1  0
 35 36  1  0
 15 17  2  0
 35 37  1  0
  7  8  1  0
  3 38  1  1
  3 18  1  0
 38 39  1  0
M  END

Alternative Forms

Associated Targets(Human)

Malme-3M (44254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MOLT-4 (49676 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.73Molecular Weight (Monoisotopic): 512.3502AlogP: 6.26#Rotatable Bonds: 7
Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.97CX LogD: 4.97
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: 3.21

References

1. Meragelman KM, McKee TC, Boyd MR..  (2001)  New cytotoxic isomalabaricane triterpenes from the sponge Jaspis species.,  64  (3): [PMID:11277766] [10.1021/np000478g]

Source