The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E/Z)-29-hydroxystelliferin A ID: ALA474075
PubChem CID: 10720560
Max Phase: Preclinical
Molecular Formula: C32H48O5
Molecular Weight: 512.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: (E/Z)-29-Hydroxystelliferin A | CHEMBL474075|(E/Z)-29-hydroxystelliferin A
Canonical SMILES: CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)/C(=C(C)/C=C/C=C(\C)[C@@H](O)CC=C(C)C)C(=O)C[C@@H]23)[C@@]1(C)CO
Standard InChI: InChI=1S/C32H48O5/c1-20(2)12-13-24(35)21(3)10-9-11-22(4)29-25(36)18-27-30(6)17-15-28(37-23(5)34)32(8,19-33)26(30)14-16-31(27,29)7/h9-12,24,26-28,33,35H,13-19H2,1-8H3/b11-9+,21-10+,29-22+/t24-,26+,27-,28-,30-,31-,32+/m0/s1
Standard InChI Key: QDIPGNADJXRSEJ-BLOHMGETSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
9.0332 -0.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0332 -1.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7476 -2.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7476 -0.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4666 -0.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4677 -1.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1827 -2.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9011 -1.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1805 -0.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9009 -0.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5219 -0.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1852 0.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3562 0.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3188 -2.1724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6044 -1.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8898 -2.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6044 -0.9349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7390 -2.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4585 -0.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6079 -1.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4585 -2.5802 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.7609 0.2062 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.5998 1.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3458 -0.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7620 -1.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7546 0.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5795 0.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9883 1.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8132 1.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2220 1.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2293 0.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0469 1.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8058 2.4993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4557 2.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2806 2.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6893 3.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6968 1.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0285 -2.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0240 -3.4052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 10 1 0
5 19 1 1
9 10 1 0
10 20 1 6
3 6 1 0
6 21 1 6
5 4 1 0
9 22 1 1
5 6 1 0
12 23 2 0
11 24 2 0
1 2 1 0
24 25 1 0
10 11 1 0
24 26 1 0
11 12 1 0
26 27 2 0
12 13 1 0
27 28 1 0
13 9 1 0
28 29 2 0
1 4 1 0
29 30 1 0
2 14 1 1
29 31 1 0
2 3 1 0
30 32 1 0
14 15 1 0
30 33 1 1
5 9 1 0
32 34 1 0
15 16 1 0
34 35 2 0
6 7 1 0
35 36 1 0
15 17 2 0
35 37 1 0
7 8 1 0
3 38 1 1
3 18 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.73Molecular Weight (Monoisotopic): 512.3502AlogP: 6.26#Rotatable Bonds: 7Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.97CX LogD: 4.97Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: 3.21
References 1. Meragelman KM, McKee TC, Boyd MR.. (2001) New cytotoxic isomalabaricane triterpenes from the sponge Jaspis species., 64 (3): [PMID:11277766 ] [10.1021/np000478g ]