(S)-2-(((R)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrodibenzo[f,h]pyrrolo[1,2-b]isoquinolin-6-yl)oxy)ethyl pyrrolidine-2-carboxylate

ID: ALA4740816

PubChem CID: 162644620

Max Phase: Preclinical

Molecular Formula: C29H34N2O5

Molecular Weight: 490.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c3c(c4ccc(OCCOC(=O)[C@@H]5CCCN5)cc4c2cc1OC)CN1CCC[C@@H]1C3

Standard InChI:  InChI=1S/C29H34N2O5/c1-33-27-15-23-21-13-18-5-4-10-31(18)17-25(21)20-8-7-19(14-22(20)24(23)16-28(27)34-2)35-11-12-36-29(32)26-6-3-9-30-26/h7-8,14-16,18,26,30H,3-6,9-13,17H2,1-2H3/t18-,26+/m1/s1

Standard InChI Key:  AOHVOLGPYVBZFU-DWXRJYCRSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    6.2059  -12.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2048  -13.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6238  -12.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9152  -12.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6266  -13.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9161  -14.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6228  -15.3146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9185  -14.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2066  -15.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2018  -16.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9149  -16.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6198  -16.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3362  -14.0783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3369  -14.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0411  -15.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0397  -13.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7484  -14.0771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7519  -14.8930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5292  -15.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0077  -14.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5235  -13.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9127  -11.6137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6192  -11.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4940  -12.4355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4938  -11.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4884  -16.5309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7403  -13.2567    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7833  -16.1177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0730  -16.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3679  -16.1085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6576  -16.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6523  -17.3297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9487  -16.0956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8685  -15.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0703  -15.1073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6571  -15.8124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2000  -16.4231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  8  2  0
  7 14  2  0
 13  5  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 13 14  1  0
 13 16  1  0
 14 15  1  0
 15 18  1  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
  4 22  1  0
 22 23  1  0
  1 24  1  0
 24 25  1  0
 10 26  1  0
 17 27  1  6
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 33  1  0
 33 31  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4740816

    ---

Associated Targets(Human)

Bel-7402 (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.60Molecular Weight (Monoisotopic): 490.2468AlogP: 4.20#Rotatable Bonds: 7
Polar Surface Area: 69.26Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.05CX LogP: 3.80CX LogD: 1.84
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: 0.21

References

1. Han G,Qing L,Wu M,Wang Y,Liu Y,Liu X,Wang Z,Ding J,Meng LH,Wang Q.  (2019)  Design, synthesis, and biological activity evaluation of (-)-6-O-desmethylantofine analogues as potent anti-cancer agents.,  27  (14.0): [PMID:31171403] [10.1016/j.bmc.2019.05.030]

Source