The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S)-3-cyclopropyl-3-[3-[[4-(5,5-dimethylcyclopenten-1-yl)-5-(2-fluoro-5-methoxyphenyl)pyrimidin-2-yl]methoxy]phenyl]propanoic acid ID: ALA4740846
PubChem CID: 162646017
Max Phase: Preclinical
Molecular Formula: C31H33FN2O4
Molecular Weight: 516.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(F)c(-c2cnc(COc3cccc([C@@H](CC(=O)O)C4CC4)c3)nc2C2=CCCC2(C)C)c1
Standard InChI: InChI=1S/C31H33FN2O4/c1-31(2)13-5-8-26(31)30-25(24-15-21(37-3)11-12-27(24)32)17-33-28(34-30)18-38-22-7-4-6-20(14-22)23(16-29(35)36)19-9-10-19/h4,6-8,11-12,14-15,17,19,23H,5,9-10,13,16,18H2,1-3H3,(H,35,36)/t23-/m0/s1
Standard InChI Key: CCZZWYVXFVNTJG-QHCPKHFHSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
18.9027 -12.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1144 -12.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3263 -13.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9095 -10.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9084 -11.4306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6206 -11.8437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3344 -11.4301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3315 -10.6033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6188 -10.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0468 -11.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7580 -11.4279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4705 -11.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4672 -12.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1788 -13.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8910 -12.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8871 -11.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1748 -11.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5927 -11.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3066 -11.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0163 -11.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7302 -11.8170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0122 -10.5865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5885 -10.5938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9931 -9.8805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1717 -9.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2008 -11.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4504 -11.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8989 -12.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3111 -12.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2038 -10.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2050 -9.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4939 -8.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7811 -9.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7840 -10.2023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4956 -10.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9130 -8.9641 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.0737 -10.6135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3603 -10.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
18 23 1 6
24 23 1 0
25 24 1 0
23 25 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 2 1 0
2 26 1 0
5 26 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
4 30 1 0
31 36 1 0
34 37 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.61Molecular Weight (Monoisotopic): 516.2424AlogP: 7.04#Rotatable Bonds: 10Polar Surface Area: 81.54Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.93CX Basic pKa: 1.37CX LogP: 6.85CX LogD: 3.62Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -0.10
References 1. Meegalla SK,Huang H,Martin T,Xu J,Zhao S,Liu J,Hall M,Gunnet J,Wang Y,Rady B,Silva J,Otieno M,Arnoult E,Paul Lee S,Pocai A,Player MR. (2018) Discovery of a novel potent GPR40 full agonist., 28 (4): [PMID:29366647 ] [10.1016/j.bmcl.2018.01.013 ]