N-(2-(difluoromethoxy)benzyl)-N-(2-(methylamino)-2-oxoethyl)-2-(octahydro-1H-isoindole-2-carbonyl)-1H-imidazole-4-carboxamide

ID: ALA4740886

PubChem CID: 162646223

Max Phase: Preclinical

Molecular Formula: C24H29F2N5O4

Molecular Weight: 489.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)CN(Cc1ccccc1OC(F)F)C(=O)c1c[nH]c(C(=O)N2CC3CCCCC3C2)n1

Standard InChI:  InChI=1S/C24H29F2N5O4/c1-27-20(32)14-31(13-17-8-4-5-9-19(17)35-24(25)26)22(33)18-10-28-21(29-18)23(34)30-11-15-6-2-3-7-16(15)12-30/h4-5,8-10,15-16,24H,2-3,6-7,11-14H2,1H3,(H,27,32)(H,28,29)

Standard InChI Key:  NIHPWKGBIKTWGP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   29.3984   -5.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0556   -6.4306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7218   -5.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4751   -5.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6588   -5.1716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6189   -6.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0167   -5.6377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4415   -6.9878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9598   -4.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7746   -4.6120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2587   -3.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9350   -3.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1221   -3.1145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6330   -3.7724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4221   -2.5512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0996   -5.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9114   -5.4553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2322   -6.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0432   -6.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5310   -5.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2019   -4.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3918   -4.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7437   -6.8597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0669   -7.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5702   -8.2530    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.8785   -7.7057    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.0974   -1.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1053   -4.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2114   -5.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8114   -5.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3606   -4.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1141   -3.7156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3181   -3.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7689   -4.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0157   -4.9222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  1  6  1  0
  6  7  1  0
  6  8  2  0
  4  9  1  0
  9 10  1  0
  9 14  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 15  1  0
 10 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 15 27  1  0
  7 28  1  0
 28 31  1  0
 30 29  1  0
 29  7  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740886

    ---

Associated Targets(Human)

TAB1 Tchem TAK1/TAB1 (257 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.52Molecular Weight (Monoisotopic): 489.2188AlogP: 2.66#Rotatable Bonds: 8
Polar Surface Area: 107.63Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.98CX Basic pKa: 0.04CX LogP: 2.16CX LogD: 2.16
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.59Np Likeness Score: -1.47

References

1. Veerman JJN,Bruseker YB,Damen E,Heijne EH,van Bruggen W,Hekking KFW,Winkel R,Hupp CD,Keefe AD,Liu J,Thomson HA,Zhang Y,Cuozzo JW,McRiner AJ,Mulvihill MJ,van Rijnsbergen P,Zech B,Renzetti LM,Babiss L,Müller G.  (2021)  Discovery of 2,4-1H-Imidazole Carboxamides as Potent and Selective TAK1 Inhibitors.,  12  (4.0): [PMID:33859795] [10.1021/acsmedchemlett.0c00547]

Source