2-((5-Bromo-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)-N-((2,4-difluorophenyl)sulfonyl)acetamide

ID: ALA4740905

PubChem CID: 162646470

Max Phase: Preclinical

Molecular Formula: C23H17BrF2N4O3S2

Molecular Weight: 579.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CSc1nnc(Br)n1-c1ccc(C2CC2)c2ccccc12)NS(=O)(=O)c1ccc(F)cc1F

Standard InChI:  InChI=1S/C23H17BrF2N4O3S2/c24-22-27-28-23(34-12-21(31)29-35(32,33)20-10-7-14(25)11-18(20)26)30(22)19-9-8-15(13-5-6-13)16-3-1-2-4-17(16)19/h1-4,7-11,13H,5-6,12H2,(H,29,31)

Standard InChI Key:  URCGWSTZPKYWPL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   30.7573  -11.0741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2852  -10.4164    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.5099   -9.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0688  -14.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3463  -12.3388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2382  -11.1386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4671  -10.4229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8303  -11.8512    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.7807  -14.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4724  -11.8451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5045   -8.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2834   -9.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3591  -15.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4924  -14.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0681  -13.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3538  -14.8022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6423  -14.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9901  -10.8269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7751  -13.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0592  -11.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9177   -9.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6920   -9.7115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4876  -13.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9385  -11.0801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3520  -13.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9042  -12.1125    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   34.2842  -11.2316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6435  -13.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6833   -8.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6807  -11.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0133  -11.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9566  -16.3345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7775  -16.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9086   -7.5874    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.4662   -9.0174    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 29 12  2  0
 30 24  2  0
 30 26  1  0
  8  6  1  0
  2 18  2  0
  4  9  1  0
 11 29  1  0
 14 23  1  0
 28 17  2  0
 21 11  2  0
 17 16  1  0
 15  4  1  0
  2 22  1  0
 25 28  1  0
  7  2  1  0
 31  8  1  0
 31  1  2  0
 19 15  1  0
 30  5  1  0
 15 25  2  0
 20 10  2  0
 16 13  1  0
 25  5  1  0
 20  7  1  0
  3 21  1  0
  1 24  1  0
 23 19  2  0
  6 20  1  0
  9 14  2  0
 22  3  2  0
 12 22  1  0
 27  2  2  0
  5 31  1  0
 16  4  2  0
 32 13  1  0
 33 32  1  0
 13 33  1  0
 11 34  1  0
 12 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740905

    ---

Associated Targets(Human)

SLC2A9 Tbio Solute carrier family 2, facilitated glucose transporter member 9 (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 579.45Molecular Weight (Monoisotopic): 577.9894AlogP: 4.94#Rotatable Bonds: 7
Polar Surface Area: 93.95Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.03CX Basic pKa: CX LogP: 5.17CX LogD: 4.22
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -1.74

References

1. Zhao T,Meng Q,Sun Z,Chen Y,Ai W,Zhao Z,Kang D,Dong Y,Liang R,Wu T,Pang J,Liu X,Zhan P.  (2020)  Novel Human Urate Transporter 1 Inhibitors as Hypouricemic Drug Candidates with Favorable Druggability.,  63  (19.0): [PMID:32897699] [10.1021/acs.jmedchem.0c00223]

Source