(R)-methyl 2-(3-(1,2,3,5,6,7-hexahydros-indacen-4-yl)ureido)-3-(pyridin-4-yl)propanoate

ID: ALA4740907

PubChem CID: 162646472

Max Phase: Preclinical

Molecular Formula: C22H25N3O3

Molecular Weight: 379.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)[C@@H](Cc1ccncc1)NC(=O)Nc1c2c(cc3c1CCC3)CCC2

Standard InChI:  InChI=1S/C22H25N3O3/c1-28-21(26)19(12-14-8-10-23-11-9-14)24-22(27)25-20-17-6-2-4-15(17)13-16-5-3-7-18(16)20/h8-11,13,19H,2-7,12H2,1H3,(H2,24,25,27)/t19-/m1/s1

Standard InChI Key:  MZTJVRQNYZSTAD-LJQANCHMSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   38.5551  -10.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9851  -11.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2687  -12.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5542  -11.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9436  -12.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2808  -13.1343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0996  -13.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7003  -12.2374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4139  -11.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1292  -12.2347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4124  -10.9986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.2670  -10.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9816  -10.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5954  -10.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2600   -9.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4390   -9.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8428  -11.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5580  -12.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2717  -11.8181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.5596  -13.0570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.9869  -12.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8413  -10.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5549  -10.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2710  -10.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9841  -10.5822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9830   -9.7564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.2629   -9.3454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5526   -9.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
 12  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 17 22  1  6
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740907

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 379.46Molecular Weight (Monoisotopic): 379.1896AlogP: 2.96#Rotatable Bonds: 5
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.66CX Basic pKa: 5.05CX LogP: 3.75CX LogD: 3.75
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.78Np Likeness Score: -0.52

References

1. Harrison D,Boutard N,Brzozka K,Bugaj M,Chmielewski S,Cierpich A,Doedens JR,Fabritius CRY,Gabel CA,Galezowski M,Kowalczyk P,Levenets O,Mroczkowska M,Palica K,Porter RA,Schultz D,Sowinska M,Topolnicki G,Urbanski P,Woyciechowski J,Watt AP.  (2020)  Discovery of a series of ester-substituted NLRP3 inflammasome inhibitors.,  30  (23): [PMID:32956781] [10.1016/j.bmcl.2020.127560]

Source