N,N-Diethyl-1-(4-methoxybenzyl)-1H-benzo[d]imidazole-2-carboxamide

ID: ALA4740988

PubChem CID: 162645306

Max Phase: Preclinical

Molecular Formula: C20H23N3O2

Molecular Weight: 337.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)C(=O)c1nc2ccccc2n1Cc1ccc(OC)cc1

Standard InChI:  InChI=1S/C20H23N3O2/c1-4-22(5-2)20(24)19-21-17-8-6-7-9-18(17)23(19)14-15-10-12-16(25-3)13-11-15/h6-13H,4-5,14H2,1-3H3

Standard InChI Key:  PKWLRNBJYNVMTJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   10.8546  -11.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8546  -12.2785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5599  -12.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5599  -11.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2693  -11.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2693  -12.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0472  -12.5265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5297  -11.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0473  -11.2017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3469  -11.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7555  -12.5718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7555  -11.1564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3469  -13.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7555  -13.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5727  -12.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9813  -13.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0420  -13.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3317  -13.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6301  -13.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9203  -13.7371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9147  -14.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6248  -14.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3317  -14.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2049  -14.9601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4993  -14.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 11 15  1  0
 15 16  1  0
  7 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4740988

    ---

Associated Targets(Human)

TSPO Tchem Translocator protein (484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 337.42Molecular Weight (Monoisotopic): 337.1790AlogP: 3.58#Rotatable Bonds: 6
Polar Surface Area: 47.36Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.66CX LogP: 3.44CX LogD: 3.44
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.69Np Likeness Score: -1.40

References

1. Vo, Sophie V., Banister, Samuel D., Freelander, Isaac, Werry, Eryn L., Reekie, Tristan A., Ittner, Lars M., Kassiou, Michael.  (2020)  Reversing binding sensitivity to A147T translocator protein,  11  (4): [PMID:33479652] [10.1039/c9md00580c]

Source