The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N5-tert-butyl-N1-((S)-1-((4-fluoronaphthalen-1-yl)methylamino)-3-methoxy-1-oxopropan-2-yl)-2-(4-methylphenylsulfonamido)pentanediamide ID: ALA4741140
PubChem CID: 162646492
Max Phase: Preclinical
Molecular Formula: C31H39FN4O6S
Molecular Weight: 614.74
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC[C@H](NC(=O)[C@H](CCC(=O)NC(C)(C)C)NS(=O)(=O)c1ccc(C)cc1)C(=O)NCc1ccc(F)c2ccccc12
Standard InChI: InChI=1S/C31H39FN4O6S/c1-20-10-13-22(14-11-20)43(40,41)36-26(16-17-28(37)35-31(2,3)4)30(39)34-27(19-42-5)29(38)33-18-21-12-15-25(32)24-9-7-6-8-23(21)24/h6-15,26-27,36H,16-19H2,1-5H3,(H,33,38)(H,34,39)(H,35,37)/t26-,27-/m0/s1
Standard InChI Key: ACKUOPORWYFMTA-SVBPBHIXSA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
15.0007 -29.1764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5924 -28.4638 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.1795 -29.1738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0383 -32.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4550 -31.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6296 -31.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3090 -28.0513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0216 -28.4597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7342 -28.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4466 -28.4554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1592 -28.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8717 -28.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5843 -28.0388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2967 -28.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0093 -28.0346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0234 -29.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7323 -27.2221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8735 -29.2764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1574 -27.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4339 -27.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7153 -26.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0062 -27.2159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4405 -28.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7235 -28.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7228 -29.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4385 -29.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1564 -29.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1535 -28.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7388 -29.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7406 -30.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4560 -30.9316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0270 -30.9347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1732 -32.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8800 -28.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8804 -27.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1654 -26.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4512 -27.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4566 -28.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1721 -28.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7349 -26.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1457 -26.7954 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.8710 -26.8038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8692 -25.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 16 1 6
9 17 2 0
12 18 2 0
11 19 1 1
15 24 2 0
23 20 2 0
20 21 1 0
21 22 2 0
22 15 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
16 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 5 1 0
5 33 1 0
7 2 1 0
2 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
37 40 1 0
20 41 1 0
19 42 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 614.74Molecular Weight (Monoisotopic): 614.2574AlogP: 3.08#Rotatable Bonds: 13Polar Surface Area: 142.70Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.35CX Basic pKa: ┄CX LogP: 2.81CX LogD: 2.81Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.23Np Likeness Score: -1.08
References 1. Zhan W,Singh PK,Ban Y,Qing X,Ah Kioon MD,Fan H,Zhao Q,Wang R,Sukenick G,Salmon J,Warren JD,Ma X,Barrat FJ,Nathan CF,Lin G. (2020) Structure-Activity Relationships of Noncovalent Immunoproteasome β5i-Selective Dipeptides., 63 (21): [PMID:33095579 ] [10.1021/acs.jmedchem.0c01520 ]