The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Artemyrianolide E ID: ALA4741149
PubChem CID: 162646766
Max Phase: Preclinical
Molecular Formula: C17H22O5
Molecular Weight: 306.36
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C[C@@H](OC(C)=O)/C=C(\C)C[C@@H]2OC(=O)C(=C)[C@H]2C[C@H]1O
Standard InChI: InChI=1S/C17H22O5/c1-9-5-13(21-12(4)18)7-10(2)15(19)8-14-11(3)17(20)22-16(14)6-9/h5,13-16,19H,2-3,6-8H2,1,4H3/b9-5+/t13-,14+,15+,16-/m0/s1
Standard InChI Key: FHHQOBBFSYZUAO-UDWIRWHESA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
11.4470 -12.7872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2303 -12.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6005 -12.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0416 -11.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3318 -12.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1760 -9.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8645 -9.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4876 -9.4111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3835 -10.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8154 -11.1384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3686 -11.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0457 -10.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6622 -9.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2575 -10.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9639 -8.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3749 -10.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0222 -9.6449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3882 -12.1030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5812 -13.6333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7516 -12.5482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.8283 -11.5085 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.4864 -8.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7782 -8.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1936 -8.1843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 1 0
4 5 1 0
5 1 1 0
6 7 1 0
6 8 1 6
6 9 1 0
9 10 2 0
10 11 1 0
10 12 1 0
11 5 1 0
7 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
4 16 1 0
14 17 1 6
3 18 2 0
2 19 2 0
5 20 1 6
4 21 1 1
8 22 1 0
22 23 1 0
22 24 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 306.36Molecular Weight (Monoisotopic): 306.1467AlogP: 2.06#Rotatable Bonds: 1Polar Surface Area: 72.83Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.70CX LogD: 1.70Aromatic Rings: ┄Heavy Atoms: 22QED Weighted: 0.46Np Likeness Score: 3.38
References 1. Tang S,Zhang XT,Ma YB,Huang XY,Geng CA,Li TZ,Zhang XM,Shen C,Su LH,Gao Z,Chen JJ. (2020) Artemyrianolides A-S, Cytotoxic Sesquiterpenoids from Artemisia myriantha., 83 (9.0): [PMID:32842729 ] [10.1021/acs.jnatprod.0c00396 ]