The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-(2-fluoro-1,4-phenylene)bis(oxy)bis(1,3-dinitrobenzene) ID: ALA4741254
PubChem CID: 162646495
Max Phase: Preclinical
Molecular Formula: C18H9FN4O10
Molecular Weight: 460.29
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])c1ccc(Oc2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(F)c2)c([N+](=O)[O-])c1
Standard InChI: InChI=1S/C18H9FN4O10/c19-13-9-12(32-17-4-1-10(20(24)25)7-14(17)22(28)29)3-6-16(13)33-18-5-2-11(21(26)27)8-15(18)23(30)31/h1-9H
Standard InChI Key: ZYUYUPPPCOYNTH-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
17.8777 -6.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8766 -7.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5846 -7.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2943 -7.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2915 -6.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5828 -5.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9976 -5.9204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9946 -5.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7025 -4.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6997 -3.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9900 -3.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2815 -3.8892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2877 -4.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1686 -7.5628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4612 -7.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4664 -6.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7598 -5.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0508 -6.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0528 -7.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7599 -7.5624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7594 -8.3811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0531 -8.7922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4685 -8.7871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3441 -5.9238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3436 -5.1066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6366 -6.3328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4153 -5.1047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4157 -5.9219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1228 -4.6958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9839 -2.6581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6895 -2.2459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2741 -2.2531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0026 -7.5618 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
2 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 1 0
21 23 2 0
20 21 1 0
24 25 1 0
24 26 2 0
18 24 1 0
27 28 1 0
27 29 2 0
9 27 1 0
30 31 1 0
30 32 2 0
11 30 1 0
4 33 1 0
M CHG 8 21 1 22 -1 24 1 25 -1 27 1 28 -1 30 1 31 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.29Molecular Weight (Monoisotopic): 460.0303AlogP: 5.04#Rotatable Bonds: 8Polar Surface Area: 191.02Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.88CX LogD: 4.88Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -0.95
References 1. Makley LN,Johnson OT,Ghanakota P,Rauch JN,Osborn D,Wu TS,Cierpicki T,Carlson HA,Gestwicki JE. (2021) Chemical validation of a druggable site on Hsp27/HSPB1 using in silico solvent mapping and biophysical methods., 34 [PMID:33549906 ] [10.1016/j.bmc.2020.115990 ]