2,2-diphenyl-N'-(3,4,5-trimethoxybenzylidene)cyclopropanecarbohydrazide

ID: ALA4741299

PubChem CID: 162647013

Max Phase: Preclinical

Molecular Formula: C26H26N2O4

Molecular Weight: 430.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=N/NC(=O)C2CC2(c2ccccc2)c2ccccc2)cc(OC)c1OC

Standard InChI:  InChI=1S/C26H26N2O4/c1-30-22-14-18(15-23(31-2)24(22)32-3)17-27-28-25(29)21-16-26(21,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,17,21H,16H2,1-3H3,(H,28,29)/b27-17+

Standard InChI Key:  WDWWQYANTYCWIN-WPWMEQJKSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   24.2036   -3.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4291   -2.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6289   -2.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2463   -2.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8377   -2.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3773   -1.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5779   -1.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0316   -2.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2903   -3.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0891   -3.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4101   -3.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1845   -4.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7543   -5.2850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5528   -5.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7747   -4.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9538   -3.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9533   -4.1524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6617   -2.9269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3692   -3.3359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0771   -2.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7846   -3.3366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7801   -4.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4868   -4.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1957   -4.1537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1935   -3.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4862   -2.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9037   -4.5617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9044   -5.3789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9000   -2.9215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6089   -3.3280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4860   -5.3791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7778   -5.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  5  4  1  0
  2  5  1  0
  3  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  3  1  0
  1 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  1  1  0
  4 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 25 29  1  0
 29 30  1  0
 23 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741299

    ---

Associated Targets(non-human)

Human alphaherpesvirus 1 (11089 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.50Molecular Weight (Monoisotopic): 430.1893AlogP: 4.17#Rotatable Bonds: 8
Polar Surface Area: 69.15Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.81CX Basic pKa: 1.79CX LogP: 4.27CX LogD: 4.27
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -0.40

References

1. McNulty J,Babu Dokuburra C,D'Aiuto L,Demers M,McClain L,Piazza P,Williamson K,Zheng W,Nimgaonkar VL.  (2020)  Synthesis of non-nucleoside anti-viral cyclopropylcarboxacyl hydrazones and initial anti-HSV-1 structure-activity relationship studies.,  30  (24): [PMID:32961320] [10.1016/j.bmcl.2020.127559]

Source