The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[(tert-butylamino)methyl]-3-carboxy-1-(4-chlorophenyl)-5-(4-nitrophenyl)-1H-pyrazole ID: ALA4741336
PubChem CID: 162647258
Max Phase: Preclinical
Molecular Formula: C21H21ClN4O4
Molecular Weight: 428.88
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)NCc1c(C(=O)O)nn(-c2ccc(Cl)cc2)c1-c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C21H21ClN4O4/c1-21(2,3)23-12-17-18(20(27)28)24-25(15-10-6-14(22)7-11-15)19(17)13-4-8-16(9-5-13)26(29)30/h4-11,23H,12H2,1-3H3,(H,27,28)
Standard InChI Key: PDLOZLGTGMNEQN-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
12.0552 -18.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2717 -19.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8559 -19.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7737 -23.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7725 -24.3127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4869 -24.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2028 -24.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2000 -23.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4851 -23.0734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4868 -22.2531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1533 -21.7673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8961 -20.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0704 -20.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8203 -21.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0411 -22.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4255 -21.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6433 -21.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4756 -22.5508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0963 -23.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8760 -22.8387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3783 -20.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1986 -20.3973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0401 -19.5622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5822 -20.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7627 -20.4130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4550 -19.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4867 -25.5498 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.6892 -22.8117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0727 -22.2642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5231 -23.6194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
11 12 2 0
10 11 1 0
12 13 1 0
13 14 2 0
14 10 1 0
9 10 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
14 15 1 0
12 21 1 0
21 22 1 0
21 23 2 0
13 24 1 0
24 25 1 0
25 2 1 0
2 26 1 0
6 27 1 0
28 29 1 0
28 30 2 0
18 28 1 0
M CHG 2 28 1 29 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.88Molecular Weight (Monoisotopic): 428.1251AlogP: 4.69#Rotatable Bonds: 6Polar Surface Area: 110.29Molecular Species: ZWITTERIONHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.97CX Basic pKa: 9.33CX LogP: 2.35CX LogD: 2.35Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -1.34
References 1. da Silva MJV,Jacomini AP,Figueiredo MC,Back DF,Foglio MA,Ruiz ALTG,Paula FR,Rosa FA. (2021) Efficient synthesis and antitumor evaluation of 4-aminomethyl-N-arylpyrazoles: Discovery of potent and selective agents for ovarian cancer., 29 [PMID:33214037 ] [10.1016/j.bmc.2020.115835 ]