(E)-N-(tert-butyl)-2-(4-chlorobenzoyl)-4-(4-fluorobenzylidene)-1-isopropyl-5-oxopyrrolidine-2-carboxamide

ID: ALA4741365

PubChem CID: 162645605

Max Phase: Preclinical

Molecular Formula: C26H28ClFN2O3

Molecular Weight: 470.97

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)N1C(=O)/C(=C/c2ccc(F)cc2)CC1(C(=O)NC(C)(C)C)C(=O)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C26H28ClFN2O3/c1-16(2)30-23(32)19(14-17-6-12-21(28)13-7-17)15-26(30,24(33)29-25(3,4)5)22(31)18-8-10-20(27)11-9-18/h6-14,16H,15H2,1-5H3,(H,29,33)/b19-14+

Standard InChI Key:  DXOZHSOPRUGFBJ-XMHGGMMESA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   16.9787   -5.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6513   -7.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4751   -7.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8862   -6.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4746   -5.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6477   -5.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2403   -6.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8863   -5.2129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7119   -5.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1974   -5.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9809   -4.7964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1953   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9384   -3.7580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2387   -8.0675    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.8043   -5.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9745   -6.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2575   -6.8554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6874   -6.8627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2534   -7.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5363   -8.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9662   -8.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2490   -8.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2171   -4.9057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5173   -6.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5135   -6.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2257   -7.2711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9407   -6.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9390   -6.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2263   -5.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6557   -7.2726    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.3873   -4.0779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2129   -4.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9683   -3.3665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  2  0
  9 10  1  0
 10  1  1  0
  1 11  1  0
 11 12  1  0
 12  9  1  0
 12 13  2  0
  2 14  1  0
  1 15  1  0
  1 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  1  0
 19 21  1  0
 19 22  1  0
 15 23  2  0
 15 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 11 31  1  0
 31 32  1  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741365

    ---

Associated Targets(Human)

Ca-Ski (420 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.97Molecular Weight (Monoisotopic): 470.1772AlogP: 5.04#Rotatable Bonds: 5
Polar Surface Area: 66.48Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.99CX LogD: 4.99
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.67

References

1. Zhu XL,Tian XQ,Xu HH,Wang HM,Chen QH,Zeng XH.  (2020)  Rhopaladins' analogue (E)-2-aroyl-4-(4-fluorobenzylidene)-5-oxopyrrolidines inhibit proliferation, promote apoptosis and down-regulation of E6/E7 mRNA in cervical cancer.,  30  (23): [PMID:32950616] [10.1016/j.bmcl.2020.127554]

Source