The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N4-tert-butoxy-N1-((S)-1-oxo-1-(quinolin-4-ylmethylamino)propan-2-yl)-2-(3-phenylpropanamido)succinamide ID: ALA4741411
PubChem CID: 129093859
Max Phase: Preclinical
Molecular Formula: C30H37N5O5
Molecular Weight: 547.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)[C@H](CC(=O)NOC(C)(C)C)NC(=O)CCc1ccccc1)C(=O)NCc1ccnc2ccccc12
Standard InChI: InChI=1S/C30H37N5O5/c1-20(28(38)32-19-22-16-17-31-24-13-9-8-12-23(22)24)33-29(39)25(18-27(37)35-40-30(2,3)4)34-26(36)15-14-21-10-6-5-7-11-21/h5-13,16-17,20,25H,14-15,18-19H2,1-4H3,(H,32,38)(H,33,39)(H,34,36)(H,35,37)/t20-,25-/m0/s1
Standard InChI Key: MTBGAOSBYWNSPB-CPJSRVTESA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
18.9382 -14.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3557 -13.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5287 -13.3223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4917 -10.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2056 -9.6152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9195 -10.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6334 -9.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3474 -10.0202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0613 -9.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7753 -10.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4892 -9.6027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2032 -10.0119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9171 -9.5985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9214 -10.8511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6316 -8.7844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7771 -10.8427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0595 -8.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7753 -9.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4926 -10.8553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0598 -10.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3433 -9.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3471 -8.7926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6316 -8.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9152 -8.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9188 -9.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6349 -10.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3445 -8.7746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6246 -8.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9140 -8.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3450 -9.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6327 -10.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6312 -10.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3414 -11.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0545 -10.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0524 -10.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6382 -11.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6400 -12.0895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3532 -10.8480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3568 -12.5012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0755 -13.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
6 14 1 6
7 15 2 0
10 16 2 0
9 17 1 1
4 18 1 0
4 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
13 31 2 0
30 27 2 0
27 28 1 0
28 29 2 0
29 13 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
14 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
39 2 1 0
2 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.66Molecular Weight (Monoisotopic): 547.2795AlogP: 2.71#Rotatable Bonds: 12Polar Surface Area: 138.52Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.41CX Basic pKa: 4.40CX LogP: 2.26CX LogD: 2.23Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -0.57
References 1. Zhan W,Singh PK,Ban Y,Qing X,Ah Kioon MD,Fan H,Zhao Q,Wang R,Sukenick G,Salmon J,Warren JD,Ma X,Barrat FJ,Nathan CF,Lin G. (2020) Structure-Activity Relationships of Noncovalent Immunoproteasome β5i-Selective Dipeptides., 63 (21): [PMID:33095579 ] [10.1021/acs.jmedchem.0c01520 ]