4-(4-Chlorobenzyl)-1-(4-methoxybenzyl)piperidine

ID: ALA4741450

PubChem CID: 162646673

Max Phase: Preclinical

Molecular Formula: C20H24ClNO

Molecular Weight: 329.87

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CN2CCC(Cc3ccc(Cl)cc3)CC2)cc1

Standard InChI:  InChI=1S/C20H24ClNO/c1-23-20-8-4-18(5-9-20)15-22-12-10-17(11-13-22)14-16-2-6-19(21)7-3-16/h2-9,17H,10-15H2,1H3

Standard InChI Key:  BJRBVZZQSBMBPL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   13.0810  -20.3586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0810  -21.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3719  -21.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6628  -21.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6628  -20.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3719  -19.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7859  -19.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4950  -20.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2041  -19.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9091  -20.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9091  -21.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2041  -21.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4950  -21.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6182  -21.5844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3273  -21.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9578  -21.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2488  -21.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5397  -21.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8347  -21.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8347  -20.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5397  -19.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2488  -20.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1256  -19.9500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
 14 15  1  0
 11 14  1  0
  1  7  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 20 23  1  0
  4 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741450

    ---

Associated Targets(Human)

MGLL Tchem Monoglyceride lipase (1909 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 329.87Molecular Weight (Monoisotopic): 329.1546AlogP: 4.80#Rotatable Bonds: 5
Polar Surface Area: 12.47Molecular Species: BASEHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.84CX LogP: 5.08CX LogD: 3.62
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.78Np Likeness Score: -0.90

References

1. Granchi C,Rizzolio F,Palazzolo S,Carmignani S,Macchia M,Saccomanni G,Manera C,Martinelli A,Minutolo F,Tuccinardi T.  (2016)  Structural Optimization of 4-Chlorobenzoylpiperidine Derivatives for the Development of Potent, Reversible, and Selective Monoacylglycerol Lipase (MAGL) Inhibitors.,  59  (22): [PMID:27809504] [10.1021/acs.jmedchem.6b01459]

Source