The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-[[4-[4-(2-aminoethoxy)pyrazol-1-yl]pyrimidin-2-yl]amino]-N,3-dimethyl-imidazo[1,5-a]pyridine-1-carboxamide ID: ALA4741509
PubChem CID: 162647262
Max Phase: Preclinical
Molecular Formula: C19H21N9O2
Molecular Weight: 407.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1nc(C)n2ccc(Nc3nccc(-n4cc(OCCN)cn4)n3)cc12
Standard InChI: InChI=1S/C19H21N9O2/c1-12-24-17(18(29)21-2)15-9-13(4-7-27(12)15)25-19-22-6-3-16(26-19)28-11-14(10-23-28)30-8-5-20/h3-4,6-7,9-11H,5,8,20H2,1-2H3,(H,21,29)(H,22,25,26)
Standard InChI Key: OMTLMENESAAZLR-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
20.9608 -17.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9596 -18.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6677 -19.0457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3773 -18.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3745 -17.8136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6659 -17.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0857 -19.0438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7928 -18.6341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4994 -19.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2044 -18.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7880 -17.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4934 -17.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2080 -17.8268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8210 -17.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4851 -16.5210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6647 -16.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6204 -17.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1177 -16.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3700 -15.2232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3184 -16.1707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1692 -15.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6634 -16.5912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3236 -16.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0688 -15.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2515 -15.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0015 -16.1129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5471 -14.6699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2125 -13.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6909 -13.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5038 -13.3448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
8 11 2 0
9 10 2 0
10 13 1 0
12 11 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
14 17 1 0
16 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
6 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 22 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.44Molecular Weight (Monoisotopic): 407.1818AlogP: 1.06#Rotatable Bonds: 7Polar Surface Area: 137.28Molecular Species: BASEHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.16CX Basic pKa: 9.27CX LogP: -0.19CX LogD: -1.94Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -1.47
References 1. Barlaam B,Boiko S,Boyd S,Dry H,Gingipalli L,Ikeda T,Johnson T,Kawatkar S,Lorthioir O,Pike A,Pollard H,Read J,Su Q,Wang H,Wang H,Wang L,Wang P,Edmondson SD. (2020) Novel potent and selective pyrazolylpyrimidine-based SYK inhibitors., 30 (22): [PMID:32877741 ] [10.1016/j.bmcl.2020.127523 ]