The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-bromophenylthio)-3-(butylamino)-1-oxo-1H-phenalene-2-carbonitrile ID: ALA4741554
PubChem CID: 162645340
Max Phase: Preclinical
Molecular Formula: C24H19BrN2OS
Molecular Weight: 463.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNC1=C(C#N)C(=O)c2cccc3c(Sc4ccc(Br)cc4)ccc1c23
Standard InChI: InChI=1S/C24H19BrN2OS/c1-2-3-13-27-23-18-11-12-21(29-16-9-7-15(25)8-10-16)17-5-4-6-19(22(17)18)24(28)20(23)14-26/h4-12,27H,2-3,13H2,1H3
Standard InChI Key: XZBIVEYODRPUMU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
11.2405 -5.5068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2387 -6.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5349 -6.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8247 -6.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1185 -5.9215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5332 -7.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8294 -7.9625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1191 -7.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1209 -6.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4106 -6.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4083 -5.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2434 -7.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2458 -8.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9561 -9.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6599 -8.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3701 -9.1821 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.3684 -9.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0786 -10.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0810 -11.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3731 -11.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3754 -12.4509 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
12.6669 -11.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6646 -10.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6616 -7.9543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9514 -7.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9490 -6.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6569 -6.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3630 -6.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3654 -7.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 3 0
3 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
6 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
22 23 2 0
17 23 1 0
15 24 1 0
24 25 2 0
12 25 1 0
25 26 1 0
2 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
24 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.40Molecular Weight (Monoisotopic): 462.0401AlogP: 6.57#Rotatable Bonds: 6Polar Surface Area: 52.89Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.04CX LogD: 6.04Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.42Np Likeness Score: -0.94
References 1. Wang Z,Song T,Guo Z,Cao K,Chen C,Feng Y,Wang H,Yin F,Zhou S,Dai J,Zhang Z. (2020) Targeting the Allosteric Pathway That Interconnects the Core-Functional Scaffold and the Distal Phosphorylation Sites for Specific Dephosphorylation of Bcl-2., 63 (22): [PMID:33197310 ] [10.1021/acs.jmedchem.0c01290 ]