N-{2-[2-(3-(1-Tricyclo[3.3.1.1(3,7)]decyl)-4-fluorophenyl)thiazol-4-yl]ethyl}-3-methylfuran-2-ylcarboxamide

ID: ALA4741629

PubChem CID: 162646081

Max Phase: Preclinical

Molecular Formula: C27H29FN2O2S

Molecular Weight: 464.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccoc1C(=O)NCCc1csc(-c2ccc(F)c(C34CC5CC(CC(C5)C3)C4)c2)n1

Standard InChI:  InChI=1S/C27H29FN2O2S/c1-16-5-7-32-24(16)25(31)29-6-4-21-15-33-26(30-21)20-2-3-23(28)22(11-20)27-12-17-8-18(13-27)10-19(9-17)14-27/h2-3,5,7,11,15,17-19H,4,6,8-10,12-14H2,1H3,(H,29,31)

Standard InChI Key:  NMPNIWJFUWOXSL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
    2.2133  -19.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8484  -18.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0142  -19.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5572  -18.8984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7639  -19.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3021  -18.7146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0116  -18.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5629  -17.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8440  -17.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3078  -17.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1186  -18.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5509  -19.3741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3667  -19.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7479  -18.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3073  -17.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4930  -17.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6819  -17.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4902  -17.0827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6257  -16.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9010  -15.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3179  -16.4714    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.3573  -15.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0384  -16.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7700  -16.0001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1688  -20.0965    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.4511  -16.4516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4006  -17.2673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1827  -16.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9072  -16.4607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4904  -15.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1263  -15.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3180  -15.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7453  -14.6941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
  6 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 15 17  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 12 25  1  0
 24 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 28  2  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741629

    ---

Associated Targets(non-human)

Trypanosoma brucei (78846 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.61Molecular Weight (Monoisotopic): 464.1934AlogP: 6.29#Rotatable Bonds: 6
Polar Surface Area: 55.13Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.23CX LogP: 5.84CX LogD: 5.84
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.33

References

1. Georgiadis, Markos-Orestis, Kourbeli, Violeta, Papanastasiou, Ioannis P., Tsotinis, Andrew, Taylor, Martin C., Kelly, John M..  (2020)  Synthesis and evaluation of novel 2,4-disubstituted arylthiazoles against T. brucei,  11  (1): [PMID:33479605] [10.1039/c9md00478e]

Source