5-(azetidine-1-carbonyl)-3-tert-butyl-2-hydroxybenzonitrile

ID: ALA4741663

PubChem CID: 162646364

Max Phase: Preclinical

Molecular Formula: C15H18N2O2

Molecular Weight: 258.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1cc(C(=O)N2CCC2)cc(C#N)c1O

Standard InChI:  InChI=1S/C15H18N2O2/c1-15(2,3)12-8-10(7-11(9-16)13(12)18)14(19)17-5-4-6-17/h7-8,18H,4-6H2,1-3H3

Standard InChI Key:  JFPDNAMJMKEPJT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   38.2470  -21.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6598  -22.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0682  -21.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5411  -22.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5399  -23.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2480  -24.1057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9576  -23.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9548  -22.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2462  -22.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8333  -22.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8331  -21.6516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.6660  -24.1037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2507  -24.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2505  -25.7361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1256  -22.8775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3374  -22.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1261  -23.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9155  -23.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3702  -22.8683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
 10 11  2  0
  7 12  1  0
 13 14  3  0
  6 13  1  0
 10 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 15  1  0
  8  2  1  0
  2 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741663

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 258.32Molecular Weight (Monoisotopic): 258.1368AlogP: 2.41#Rotatable Bonds: 1
Polar Surface Area: 64.33Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.74CX Basic pKa: CX LogP: 2.26CX LogD: 2.10
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.84Np Likeness Score: -1.24

References

1. Uda J,Kobashi S,Ashizawa N,Matsumoto K,Iwanaga T.  (2021)  Novel monocyclic amide-linked phenol derivatives without mitochondrial toxicity have potent uric acid-lowering activity.,  40  [PMID:33684442] [10.1016/j.bmcl.2021.127900]

Source