(E)-4-((2-(7-chloroquinolin-4-yl)hydrazono)methyl)benzoic acid

ID: ALA4741720

PubChem CID: 9784938

Max Phase: Preclinical

Molecular Formula: C17H12ClN3O2

Molecular Weight: 325.76

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(/C=N/Nc2ccnc3cc(Cl)ccc23)cc1

Standard InChI:  InChI=1S/C17H12ClN3O2/c18-13-5-6-14-15(7-8-19-16(14)9-13)21-20-10-11-1-3-12(4-2-11)17(22)23/h1-10H,(H,19,21)(H,22,23)/b20-10+

Standard InChI Key:  XFWHSKTZLBZSOC-KEBDBYFISA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   29.0213   -4.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0201   -5.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7282   -5.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7264   -3.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3128   -5.4686    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.4350   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4357   -5.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1443   -5.4652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8525   -5.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8478   -4.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1387   -3.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1327   -3.0124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8373   -2.5986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5480   -3.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2527   -2.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9664   -2.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6706   -2.5828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6650   -1.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9493   -1.3616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2481   -1.7771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3691   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0804   -1.7524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3620   -0.5329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  7  2  0
  6  4  2  0
  4  1  1  0
  2  5  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
M  END

Associated Targets(non-human)

Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 325.76Molecular Weight (Monoisotopic): 325.0618AlogP: 4.03#Rotatable Bonds: 4
Polar Surface Area: 74.58Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.34CX Basic pKa: 5.87CX LogP: 2.67CX LogD: 1.35
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.56Np Likeness Score: -1.34

References

1. Marinho JA,Martins Guimarães DS,Glanzmann N,de Almeida Pimentel G,Karine da Costa Nunes I,Gualberto Pereira HM,Navarro M,de Pilla Varotti F,David da Silva A,Abramo C.  (2021)  In vitro and in vivo antiplasmodial activity of novel quinoline derivative compounds by molecular hybridization.,  215  [PMID:33596489] [10.1016/j.ejmech.2021.113271]

Source