(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl)-5-phenylpentanamide

ID: ALA4741726

PubChem CID: 162646876

Max Phase: Preclinical

Molecular Formula: C32H38N4O6

Molecular Weight: 574.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCCc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)NO

Standard InChI:  InChI=1S/C32H38N4O6/c1-23(37)33-29(22-42-21-26-16-9-4-10-17-26)31(39)34-27(19-11-18-24-12-5-2-6-13-24)30(38)35-28(32(40)36-41)20-25-14-7-3-8-15-25/h2-10,12-17,27-29,41H,11,18-22H2,1H3,(H,33,37)(H,34,39)(H,35,38)(H,36,40)/t27-,28-,29+/m1/s1

Standard InChI Key:  DUCALYUFGMEPEE-NLDZOOGBSA-N

Molfile:  

 
     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
    2.7000   -6.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4145   -5.7792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9855   -5.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7000   -7.0168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1290   -6.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8435   -5.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5579   -6.1917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8435   -4.9542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2724   -5.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9869   -6.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2724   -4.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9869   -7.0168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7013   -5.7792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4158   -6.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1303   -5.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4158   -7.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1303   -7.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8447   -6.1917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5592   -5.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1303   -4.9542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1264   -8.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8401   -8.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5556   -8.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5528   -7.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8387   -7.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1290   -7.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8435   -7.4292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8435   -8.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5579   -8.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5556   -9.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2692   -9.9052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9847   -9.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9820   -8.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2678   -8.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9869   -4.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9869   -3.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7013   -3.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4147   -3.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1287   -3.3089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1292   -2.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4097   -2.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6986   -2.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741726

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.68Molecular Weight (Monoisotopic): 574.2791AlogP: 2.45#Rotatable Bonds: 16
Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 2.88CX LogD: 2.86
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.13Np Likeness Score: -0.01

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source