The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-Ethoxy-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)-N-(2-hydroxy-2-methylpropyl)-3-methoxybenzamide ID: ALA4741733
PubChem CID: 118286449
Max Phase: Preclinical
Molecular Formula: C20H25N5O4
Molecular Weight: 399.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1nc(Nc2ccc(C(=O)NCC(C)(C)O)cc2OC)nc2[nH]ccc12
Standard InChI: InChI=1S/C20H25N5O4/c1-5-29-18-13-8-9-21-16(13)24-19(25-18)23-14-7-6-12(10-15(14)28-4)17(26)22-11-20(2,3)27/h6-10,27H,5,11H2,1-4H3,(H,22,26)(H2,21,23,24,25)
Standard InChI Key: PBUIMZPVMYITCU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
17.3288 -3.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3277 -4.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0357 -4.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7454 -4.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7425 -3.6407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0339 -3.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4487 -3.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4456 -2.4123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6196 -4.8719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9123 -4.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9174 -3.6457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2109 -3.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2110 -4.8715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5039 -4.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5016 -3.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7184 -3.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2366 -4.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7221 -4.7224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2126 -2.4194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5057 -2.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5074 -1.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1580 -3.6354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0355 -5.6900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7431 -6.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8641 -3.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5734 -3.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2795 -3.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5764 -4.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2788 -4.0364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
2 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 15 2 0
14 13 2 0
13 10 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
12 19 1 0
19 20 1 0
20 21 1 0
7 22 1 0
3 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.45Molecular Weight (Monoisotopic): 399.1907AlogP: 2.61#Rotatable Bonds: 8Polar Surface Area: 121.39Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.85CX Basic pKa: 4.71CX LogP: 2.35CX LogD: 2.35Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -0.98
References 1. Ding X,Stasi LP,Ho MH,Zhao B,Wang H,Long K,Xu Q,Sang Y,Sun C,Hu H,Yu H,Wan Z,Wang L,Edge C,Liu Q,Li Y,Dong K,Guan X,Tattersall FD,Reith AD,Ren F. (2018) Discovery of 4-ethoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amines as potent, selective and orally bioavailable LRRK2 inhibitors., 28 (9.0): [PMID:29588215 ] [10.1016/j.bmcl.2018.03.045 ]