(Z)-Octadec-9-enoic acid 4-[((S)-2-amino-2-carboxy-ethoxy)-hydroxy-phosphoryloxy]-butyl ester

ID: ALA4741744

PubChem CID: 162646889

Max Phase: Preclinical

Molecular Formula: C25H48NO8P

Molecular Weight: 521.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCOP(=O)(O)OC[C@H](N)C(=O)O

Standard InChI:  InChI=1S/C25H48NO8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-24(27)32-20-17-18-21-33-35(30,31)34-22-23(26)25(28)29/h9-10,23H,2-8,11-22,26H2,1H3,(H,28,29)(H,30,31)/b10-9-/t23-/m0/s1

Standard InChI Key:  IFPSMPWJVBKVTN-AXKWSIDASA-N

Molfile:  

 
     RDKit          2D

 35 34  0  0  0  0  0  0  0  0999 V2000
    9.2762  -15.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2752  -16.4242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9708  -15.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6874  -15.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3840  -15.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1006  -15.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7972  -15.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5138  -15.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2104  -15.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9270  -15.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5651  -15.2047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9476  -16.3019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2504  -16.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5326  -16.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8354  -16.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1176  -16.3730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4204  -16.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7027  -16.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0054  -16.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9044  -14.4907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3171  -15.2006    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    4.7255  -14.4882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1957  -15.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9034  -15.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4880  -15.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7803  -15.6133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4880  -14.3875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1957  -16.4305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6111  -15.6133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0265  -15.6133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7342  -15.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4419  -15.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1496  -15.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8574  -15.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0260  -17.6518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 21 20  2  0
 22 21  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  2  0
 23 28  1  6
 24 29  1  0
 29 21  1  0
 21 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 11  1  0
 19 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741744

    ---

Associated Targets(non-human)

Gpr34 G protein-coupled receptor 34 (411 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
P2ry10 Putative P2Y purinoceptor 10 (276 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.63Molecular Weight (Monoisotopic): 521.3118AlogP: 5.89#Rotatable Bonds: 25
Polar Surface Area: 145.38Molecular Species: ZWITTERIONHBA: 7HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.62CX Basic pKa: 9.38CX LogP: 4.44CX LogD: 1.33
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.06Np Likeness Score: 0.90

References

1. Nakamura S,Sayama M,Uwamizu A,Jung S,Ikubo M,Otani Y,Kano K,Omi J,Inoue A,Aoki J,Ohwada T.  (2020)  Non-naturally Occurring Regio Isomer of Lysophosphatidylserine Exhibits Potent Agonistic Activity toward G Protein-Coupled Receptors.,  63  (17): [PMID:32787112] [10.1021/acs.jmedchem.0c01126]

Source