The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-cyclohexyl-N-(5-(N,N-diisopropylsulfamoyl)-2-methylphenyl)-2-(3-(2-(3,4-dimethoxyphenyl)acetyl)guanidino)propanamide Trifluoroacetic acid ID: ALA4741771
PubChem CID: 162647141
Max Phase: Preclinical
Molecular Formula: C35H50F3N5O8S
Molecular Weight: 643.85
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC(=O)NC(=N)N[C@H](CC2CCCCC2)C(=O)Nc2cc(S(=O)(=O)N(C(C)C)C(C)C)ccc2C)cc1OC.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C33H49N5O6S.C2HF3O2/c1-21(2)38(22(3)4)45(41,42)26-15-13-23(5)27(20-26)35-32(40)28(17-24-11-9-8-10-12-24)36-33(34)37-31(39)19-25-14-16-29(43-6)30(18-25)44-7;3-2(4,5)1(6)7/h13-16,18,20-22,24,28H,8-12,17,19H2,1-7H3,(H,35,40)(H3,34,36,37,39);(H,6,7)/t28-;/m1./s1
Standard InChI Key: CEVSOCLWOOMPQA-LNLSOMNWSA-N
Molfile:
RDKit 2D
52 53 0 0 0 0 0 0 0 0999 V2000
13.2032 -25.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9150 -25.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6269 -25.6033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9150 -24.3734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4913 -25.1948 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2032 -26.4247 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.4892 -26.0119 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1755 -23.8306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7669 -23.1249 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3580 -23.8280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4837 -21.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4825 -22.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1947 -23.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9085 -22.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9057 -21.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1929 -21.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6159 -21.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6210 -23.1256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3322 -22.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0446 -23.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3309 -21.8904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7517 -22.7095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7504 -21.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4616 -21.4785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0421 -21.4807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0589 -22.7133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3508 -23.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0595 -21.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0459 -23.9447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7543 -24.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7518 -25.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4602 -25.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1738 -25.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1745 -24.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4616 -23.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1689 -21.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8770 -21.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1682 -22.7050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5843 -21.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5804 -22.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2869 -23.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9960 -22.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9941 -21.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2870 -21.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 -22.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3521 -21.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7008 -21.4743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4095 -21.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7038 -23.1145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7041 -23.9317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3537 -23.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7675 -21.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
9 8 2 0
10 9 2 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
15 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
12 9 1 0
9 26 1 0
26 27 1 0
26 28 1 0
20 29 1 6
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
24 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
27 45 1 0
28 46 1 0
43 47 1 0
47 48 1 0
42 49 1 0
49 50 1 0
27 51 1 0
28 52 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 643.85Molecular Weight (Monoisotopic): 643.3404AlogP: 4.98#Rotatable Bonds: 13Polar Surface Area: 149.92Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.36CX Basic pKa: 8.05CX LogP: 5.21CX LogD: 4.48Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.18Np Likeness Score: -0.81
References 1. Goyal S,Patel KV,Nagare Y,Raykar DB,Raikar SS,Dolas A,Khurana P,Cyriac R,Sarak S,Gangar M,Agarwal AK,Kulkarni A. (2021) Identification and structure-activity relationship studies of small molecule inhibitors of the human cathepsin D., 29 [PMID:33271453 ] [10.1016/j.bmc.2020.115879 ]