The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[(3-chloro-4-methoxy-phenyl)methylamino]-2-[(3R)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-N-(2-pyridylmethyl)pyrimidine-5-carboxamide ID: ALA4741817
PubChem CID: 162645480
Max Phase: Preclinical
Molecular Formula: C29H29ClN6O3
Molecular Weight: 545.04
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNc2nc(N3Cc4ccccc4C[C@@H]3CO)ncc2C(=O)NCc2ccccn2)cc1Cl
Standard InChI: InChI=1S/C29H29ClN6O3/c1-39-26-10-9-19(12-25(26)30)14-32-27-24(28(38)33-15-22-8-4-5-11-31-22)16-34-29(35-27)36-17-21-7-3-2-6-20(21)13-23(36)18-37/h2-12,16,23,37H,13-15,17-18H2,1H3,(H,33,38)(H,32,34,35)/t23-/m1/s1
Standard InChI Key: WDBFSZFOLCDJAC-HSZRJFAPSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
30.7836 -15.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7824 -16.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4946 -16.9821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2084 -16.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2056 -15.7459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4928 -15.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9209 -16.9801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0703 -16.9812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0696 -17.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3575 -18.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6477 -17.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9360 -18.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9349 -19.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6514 -19.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3602 -19.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2288 -17.7965 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.2274 -19.4413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5154 -19.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0716 -15.3369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0715 -14.5156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3599 -15.7498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3595 -14.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6478 -14.5159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9370 -14.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2299 -14.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2297 -15.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9425 -15.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6508 -15.3323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9179 -17.8016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6222 -18.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6235 -16.5686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3365 -16.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3319 -17.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0378 -18.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7488 -17.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7494 -16.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0429 -16.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2051 -18.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2033 -19.0341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
2 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
12 16 1 0
13 17 1 0
17 18 1 0
1 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
7 29 1 0
7 31 1 0
29 30 1 0
30 33 1 0
32 31 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
29 38 1 6
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.04Molecular Weight (Monoisotopic): 544.1990AlogP: 4.00#Rotatable Bonds: 9Polar Surface Area: 112.50Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.83CX Basic pKa: 5.52CX LogP: 4.52CX LogD: 4.52Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.29
References 1. Shaaban MA,Elshaier YAMM,Hammad AH,Farag NA,Hassan Haredy H,AbdEl-Ghany AA,Mohamed KO. (2020) Design and synthesis of pyrazolo[3,4-d]pyrimidinone derivatives: Discovery of selective phosphodiesterase-5 inhibitors., 30 (16): [PMID:32631538 ] [10.1016/j.bmcl.2020.127337 ]