The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(10,11-Dihydro-5H-dibenzo[b,f]azepin-5-yl)(4-(3-(pyrrolidin-1-yl)propoxy)phenyl)methanone ID: ALA4741821
PubChem CID: 162645482
Max Phase: Preclinical
Molecular Formula: C28H30N2O2
Molecular Weight: 426.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(OCCCN2CCCC2)cc1)N1c2ccccc2CCc2ccccc21
Standard InChI: InChI=1S/C28H30N2O2/c31-28(24-14-16-25(17-15-24)32-21-7-20-29-18-5-6-19-29)30-26-10-3-1-8-22(26)12-13-23-9-2-4-11-27(23)30/h1-4,8-11,14-17H,5-7,12-13,18-21H2
Standard InChI Key: XYMFBHODYQGKBI-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
5.1783 -13.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1771 -13.8285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8893 -14.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6031 -13.8280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6002 -12.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8875 -12.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3155 -14.2355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0226 -13.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7351 -14.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4463 -13.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1588 -14.2311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4663 -12.5923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7546 -13.0052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4661 -11.7710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2457 -15.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0494 -15.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4611 -14.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9091 -13.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0516 -9.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8718 -9.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3853 -10.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2029 -11.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8026 -11.9623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5850 -11.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7642 -10.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1631 -10.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7285 -11.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5427 -10.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7555 -10.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1534 -10.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3479 -11.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1348 -11.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
1 12 1 0
12 13 2 0
12 14 1 0
11 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 11 1 0
14 27 1 0
14 22 1 0
28 19 1 0
19 20 1 0
21 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.56Molecular Weight (Monoisotopic): 426.2307AlogP: 5.63#Rotatable Bonds: 6Polar Surface Area: 32.78Molecular Species: BASEHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.34CX LogP: 5.48CX LogD: 3.55Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -0.95
References 1. Cardoso FC,Marliac MA,Geoffroy C,Schmit M,Bispat A,Lewis RJ,Tuck KL,Duggan PJ. (2020) The neuronal calcium ion channel activity of constrained analogues of MONIRO-1., 28 (18): [PMID:32828422 ] [10.1016/j.bmc.2020.115655 ]