(10,11-Dihydro-5H-dibenzo[b,f]azepin-5-yl)(4-(3-(pyrrolidin-1-yl)propoxy)phenyl)methanone

ID: ALA4741821

PubChem CID: 162645482

Max Phase: Preclinical

Molecular Formula: C28H30N2O2

Molecular Weight: 426.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(OCCCN2CCCC2)cc1)N1c2ccccc2CCc2ccccc21

Standard InChI:  InChI=1S/C28H30N2O2/c31-28(24-14-16-25(17-15-24)32-21-7-20-29-18-5-6-19-29)30-26-10-3-1-8-22(26)12-13-23-9-2-4-11-27(23)30/h1-4,8-11,14-17H,5-7,12-13,18-21H2

Standard InChI Key:  XYMFBHODYQGKBI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    5.1783  -13.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1771  -13.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8893  -14.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6031  -13.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6002  -12.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8875  -12.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3155  -14.2355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0226  -13.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7351  -14.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4463  -13.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1588  -14.2311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4663  -12.5923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7546  -13.0052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4661  -11.7710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2457  -15.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0494  -15.2146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4611  -14.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9091  -13.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0516   -9.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8718   -9.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3853  -10.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2029  -11.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8026  -11.9623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5850  -11.7225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7642  -10.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1631  -10.3670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7285  -11.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5427  -10.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7555  -10.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1534  -10.9384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3479  -11.7434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1348  -11.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  1 12  1  0
 12 13  2  0
 12 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 11  1  0
 14 27  1  0
 14 22  1  0
 28 19  1  0
 19 20  1  0
 21 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741821

    ---

Associated Targets(Human)

CACNA1B Tclin Voltage-gated N-type calcium channel alpha-1B subunit (743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.56Molecular Weight (Monoisotopic): 426.2307AlogP: 5.63#Rotatable Bonds: 6
Polar Surface Area: 32.78Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.34CX LogP: 5.48CX LogD: 3.55
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -0.95

References

1. Cardoso FC,Marliac MA,Geoffroy C,Schmit M,Bispat A,Lewis RJ,Tuck KL,Duggan PJ.  (2020)  The neuronal calcium ion channel activity of constrained analogues of MONIRO-1.,  28  (18): [PMID:32828422] [10.1016/j.bmc.2020.115655]

Source