The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-((R)-2-amino-3-phenylpropanoyl)-N-((1-carbamimidoylpiperidin-4-yl)methyl)pyrrolidine-2-carboxamide ID: ALA4741823
PubChem CID: 9843969
Max Phase: Preclinical
Molecular Formula: C21H32N6O2
Molecular Weight: 400.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)N1CCC(CNC(=O)[C@@H]2CCCN2C(=O)[C@H](N)Cc2ccccc2)CC1
Standard InChI: InChI=1S/C21H32N6O2/c22-17(13-15-5-2-1-3-6-15)20(29)27-10-4-7-18(27)19(28)25-14-16-8-11-26(12-9-16)21(23)24/h1-3,5-6,16-18H,4,7-14,22H2,(H3,23,24)(H,25,28)/t17-,18+/m1/s1
Standard InChI Key: MQLNFLUDIXFKTN-MSOLQXFVSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
10.0457 -13.2732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0415 -12.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3318 -12.0510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3277 -11.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6179 -10.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0333 -10.8216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5251 -10.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7249 -9.8513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3199 -10.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8698 -11.1655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7036 -11.9656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9276 -12.2218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3134 -12.5096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3178 -11.6778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7614 -13.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9854 -13.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3778 -12.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6024 -12.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4356 -13.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0504 -14.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8234 -14.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3382 -13.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3404 -14.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0484 -14.9066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7558 -14.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7553 -13.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0494 -15.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3422 -16.1333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7576 -16.1315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 1
4 6 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
12 15 1 1
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
1 22 1 0
1 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 2 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.53Molecular Weight (Monoisotopic): 400.2587AlogP: 0.27#Rotatable Bonds: 6Polar Surface Area: 128.54Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 12.13CX LogP: -0.17CX LogD: -3.06Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.40Np Likeness Score: -0.64
References 1. Sandner A,Ngo K,Schiebel J,Pizarroso AIM,Schmidt L,Wenzel B,Steinmetzer T,Ostermann A,Heine A,Klebe G. (2021) How a Fragment Draws Attention to Selectivity Discriminating Features between the Related Proteases Trypsin and Thrombin., 64 (3.0): [PMID:33471524 ] [10.1021/acs.jmedchem.0c01809 ]