6-(2-Fluoro-6-methylphenyl)-1-(4-(4-methylpiperazin-1-yl)phenyl)-1H-indazole

ID: ALA4741876

PubChem CID: 162646523

Max Phase: Preclinical

Molecular Formula: C25H25FN4

Molecular Weight: 400.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(F)c1-c1ccc2cnn(-c3ccc(N4CCN(C)CC4)cc3)c2c1

Standard InChI:  InChI=1S/C25H25FN4/c1-18-4-3-5-23(26)25(18)19-6-7-20-17-27-30(24(20)16-19)22-10-8-21(9-11-22)29-14-12-28(2)13-15-29/h3-11,16-17H,12-15H2,1-2H3

Standard InChI Key:  GONTZZGHVIOSOV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    4.6166   -7.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6154   -7.9309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3299   -8.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3281   -6.6916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0430   -7.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0478   -7.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8348   -8.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3165   -7.5059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8271   -6.8407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0772   -6.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9025   -6.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9057   -5.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1924   -5.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4775   -5.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6206   -5.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1942   -7.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4769   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1995   -7.9285    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.8845   -5.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1348   -5.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5792   -4.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7701   -4.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5237   -5.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8283   -3.7024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6398   -3.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8897   -2.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3365   -2.1366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5299   -2.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2765   -3.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5887   -1.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
  1 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 17  1  0
 16 11  1  0
 12 15  1  0
 16 17  2  0
 16 18  1  0
 10 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 10  1  0
 21 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741876

    ---

Associated Targets(Human)

MAP4K1 Tchem Mitogen-activated protein kinase kinase kinase kinase 1 (947 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.50Molecular Weight (Monoisotopic): 400.2063AlogP: 4.89#Rotatable Bonds: 3
Polar Surface Area: 24.30Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.91CX LogP: 5.34CX LogD: 4.71
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: -1.41

References

1. Yu EC,Methot JL,Fradera X,Lesburg CA,Lacey BM,Siliphaivanh P,Liu P,Smith DM,Xu Z,Piesvaux JA,Kawamura S,Xu H,Miller JR,Bittinger M,Pasternak A.  (2021)  Identification of Potent Reverse Indazole Inhibitors for HPK1.,  12  (3.0): [PMID:33738073] [10.1021/acsmedchemlett.0c00672]

Source