5-[2-[4-(cyclopropanecarbonylamino)butylcarbamoyl]phenyl]-N-(3-pyrrolidin-1-ylpropyl)pyridine-3-carboxamide

ID: ALA4741918

PubChem CID: 162647028

Max Phase: Preclinical

Molecular Formula: C28H37N5O3

Molecular Weight: 491.64

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCCN1CCCC1)c1cncc(-c2ccccc2C(=O)NCCCCNC(=O)C2CC2)c1

Standard InChI:  InChI=1S/C28H37N5O3/c34-26(21-10-11-21)30-12-3-4-13-32-28(36)25-9-2-1-8-24(25)22-18-23(20-29-19-22)27(35)31-14-7-17-33-15-5-6-16-33/h1-2,8-9,18-21H,3-7,10-17H2,(H,30,34)(H,31,35)(H,32,36)

Standard InChI Key:  WKLOSYPDNLGIKG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   13.0365  -22.7781    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0354  -23.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7434  -24.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4572  -23.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4544  -22.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7416  -22.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1646  -22.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8780  -22.7692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1616  -21.5378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5883  -22.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3017  -22.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0120  -22.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7253  -22.7585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8104  -23.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6145  -23.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0204  -23.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4671  -22.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7425  -24.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0326  -25.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0310  -26.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7386  -26.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4493  -26.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4474  -25.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1546  -24.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8628  -25.2282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1536  -24.0033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5700  -24.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2782  -25.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9854  -24.8169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6936  -25.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4008  -24.8151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1090  -25.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8162  -24.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1101  -26.0400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6305  -24.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2211  -24.1046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  3 18  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 35 33  1  0
 36 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741918

    ---

Associated Targets(Human)

SMYD2 Tchem N-lysine methyltransferase SMYD2 (395 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.64Molecular Weight (Monoisotopic): 491.2896AlogP: 3.00#Rotatable Bonds: 13
Polar Surface Area: 103.43Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.95CX Basic pKa: 9.28CX LogP: 1.41CX LogD: -0.46
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.34

References

1. Zhang B,Liao L,Wu F,Zhang F,Sun Z,Chen H,Luo C.  (2020)  Synthesis and structure-activity relationship studies of LLY-507 analogues as SMYD2 inhibitors.,  30  (22): [PMID:33011288] [10.1016/j.bmcl.2020.127598]

Source