(E)-5-(((2-((7-chloroquinolin-4-yl)amino)ethyl)imino)methyl)benzene-1,3-diol

ID: ALA4741933

PubChem CID: 162647148

Max Phase: Preclinical

Molecular Formula: C18H16ClN3O2

Molecular Weight: 341.80

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1cc(O)cc(/C=N/CCNc2ccnc3cc(Cl)ccc23)c1

Standard InChI:  InChI=1S/C18H16ClN3O2/c19-13-1-2-16-17(3-4-21-18(16)9-13)22-6-5-20-11-12-7-14(23)10-15(24)8-12/h1-4,7-11,23-24H,5-6H2,(H,21,22)/b20-11+

Standard InChI Key:  FSSGZPUTQZPVST-RGVLZGJSSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   12.9674   -7.7596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6781   -8.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3828   -7.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0965   -8.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8007   -7.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7951   -6.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0794   -6.5226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3781   -6.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7359   -9.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7348  -10.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4428  -10.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4410   -9.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0275  -10.6400    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.1497   -9.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1504  -10.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8590  -10.6367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5672  -10.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5625   -9.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8534   -9.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8473   -8.1839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5520   -7.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2627   -8.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0728   -5.7045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5120   -8.1496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 15  2  0
 14 12  2  0
 12  9  1  0
 10 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22  1  1  0
  7 23  1  0
  5 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741933

    ---

Associated Targets(non-human)

Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 341.80Molecular Weight (Monoisotopic): 341.0931AlogP: 3.83#Rotatable Bonds: 5
Polar Surface Area: 77.74Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.98CX Basic pKa: 7.30CX LogP: 3.23CX LogD: 3.09
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.49Np Likeness Score: -0.77

References

1. Marinho JA,Martins Guimarães DS,Glanzmann N,de Almeida Pimentel G,Karine da Costa Nunes I,Gualberto Pereira HM,Navarro M,de Pilla Varotti F,David da Silva A,Abramo C.  (2021)  In vitro and in vivo antiplasmodial activity of novel quinoline derivative compounds by molecular hybridization.,  215  [PMID:33596489] [10.1016/j.ejmech.2021.113271]

Source